EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CHO3.Na |
| Net Charge | 0 |
| Average Mass | 84.006 |
| Monoisotopic Mass | 83.98234 |
| SMILES | O=C([O-])O.[Na+] |
| InChI | InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| InChIKey | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. |
| Biological Roles: | food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. antacid Any substance which is used to neutralise stomach acidity. |
| Applications: | food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. antacid Any substance which is used to neutralise stomach acidity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium hydrogencarbonate (CHEBI:32139) has part hydrogencarbonate (CHEBI:17544) |
| sodium hydrogencarbonate (CHEBI:32139) has role antacid (CHEBI:65265) |
| sodium hydrogencarbonate (CHEBI:32139) has role food anticaking agent (CHEBI:77965) |
| sodium hydrogencarbonate (CHEBI:32139) is a one-carbon compound (CHEBI:64708) |
| sodium hydrogencarbonate (CHEBI:32139) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium hydrogencarbonate |
| Synonyms | Source |
|---|---|
| baking soda | ChemIDplus |
| bicarbonate of soda | ChemIDplus |
| carbonic acid monosodium salt | ChemIDplus |
| E 500 | ChEBI |
| E-500 | ChEBI |
| E500 | ChEBI |