EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O5S |
| Net Charge | 0 |
| Average Mass | 364.423 |
| Monoisotopic Mass | 364.10929 |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | MAEIEVLCKWDQJH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor A EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of channel-conductance-controlling ATPase (EC 3.6.3.49, also known as cystic fibrosis conductance regulator, CFCR). |
| Application: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bumetanide (CHEBI:3213) has role diuretic (CHEBI:35498) |
| bumetanide (CHEBI:3213) has role EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor (CHEBI:131770) |
| bumetanide (CHEBI:3213) is a amino acid (CHEBI:33709) |
| bumetanide (CHEBI:3213) is a benzoic acids (CHEBI:22723) |
| bumetanide (CHEBI:3213) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| INNs | Source |
|---|---|
| bumetanida | ChemIDplus |
| bumetanide | ChemIDplus |
| bumetanidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(aminosulfonyl)-5-(butylamino)-4-phenoxybenzoic acid | ChemIDplus |
| 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid | ChEMBL |
| 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid | ChEMBL |
| 3-butylamino-4-(phenoxy)-5-sulfamoylbenzoic acid | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 427 | DrugCentral |
| Bumetanide | Wikipedia |
| D00247 | KEGG DRUG |
| DB00887 | DrugBank |
| DE1964503 | Patent |
| DE1964504 | Patent |
| HMDB0015024 | HMDB |
| LSM-2848 | LINCS |
| US3806534 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2185351 | Reaxys |
| CAS:28395-03-1 | KEGG DRUG |
| CAS:28395-03-1 | ChemIDplus |
| Citations |
|---|