EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O5S |
| Net Charge | 0 |
| Average Mass | 364.423 |
| Monoisotopic Mass | 364.10929 |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | MAEIEVLCKWDQJH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor A EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of channel-conductance-controlling ATPase (EC 3.6.3.49, also known as cystic fibrosis conductance regulator, CFCR). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. hypoglycemic agent A drug which lowers the blood glucose level. renoprotective agent Any compound that is able to prevent damage to the kidneys. diuretic An agent that promotes the excretion of urine through its effects on kidney function. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bumetanide (CHEBI:3213) has role anticonvulsant (CHEBI:35623) |
| bumetanide (CHEBI:3213) has role antineoplastic agent (CHEBI:35610) |
| bumetanide (CHEBI:3213) has role cardiovascular drug (CHEBI:35554) |
| bumetanide (CHEBI:3213) has role diuretic (CHEBI:35498) |
| bumetanide (CHEBI:3213) has role EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor (CHEBI:131770) |
| bumetanide (CHEBI:3213) has role hypoglycemic agent (CHEBI:35526) |
| bumetanide (CHEBI:3213) has role renoprotective agent (CHEBI:231911) |
| bumetanide (CHEBI:3213) is a amino acid (CHEBI:33709) |
| bumetanide (CHEBI:3213) is a benzoic acids (CHEBI:22723) |
| bumetanide (CHEBI:3213) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| INNs | Source |
|---|---|
| bumetanida | ChemIDplus |
| bumetanide | ChemIDplus |
| bumetanidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(aminosulfonyl)-5-(butylamino)-4-phenoxybenzoic acid | ChemIDplus |
| 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid | ChEMBL |
| 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid | ChEMBL |
| 3-butylamino-4-(phenoxy)-5-sulfamoylbenzoic acid | DrugBank |
| PF-1593 | ChEMBL |
| PF1593 | ChEMBL |
| Brand Names | Source |
|---|---|
| Betinex | ChEMBL |
| Bumex | ChEMBL |
| Burinex | ChEMBL |
| Lixil | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 427 | DrugCentral |
| Bumetanide | Wikipedia |
| D00247 | KEGG DRUG |
| DB00887 | DrugBank |
| DE1964503 | Patent |
| DE1964504 | Patent |
| HMDB0015024 | HMDB |
| LSM-2848 | LINCS |
| US3806534 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2185351 | Reaxys |
| CAS:28395-03-1 | ChemIDplus |
| CAS:28395-03-1 | KEGG DRUG |
| Citations |
|---|