EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO4 |
| Net Charge | 0 |
| Average Mass | 325.364 |
| Monoisotopic Mass | 325.13141 |
| SMILES | [H][C@]12Cc3ccc(OC)c(O)c3-c3c4c(cc(c31)CCN2C)OCO4 |
| InChI | InChI=1S/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | LODGIKWNLDQZBM-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor An EC 1.14.16.* (oxidoreductase acting on paired donors, reduced pteridine as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosine 3-monooxygenase (EC 1.14.16.2). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.4.3.22 (diamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of diamine oxidase (EC 1.4.3.22). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bulbocapnine (CHEBI:3211) has functional parent aporphine (CHEBI:35643) |
| bulbocapnine (CHEBI:3211) has role EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor (CHEBI:63932) |
| bulbocapnine (CHEBI:3211) has role EC 1.4.3.22 (diamine oxidase) inhibitor (CHEBI:53659) |
| bulbocapnine (CHEBI:3211) has role plant metabolite (CHEBI:76924) |
| bulbocapnine (CHEBI:3211) is a aporphine alkaloid (CHEBI:134209) |
| bulbocapnine (CHEBI:3211) is a aromatic ether (CHEBI:35618) |
| bulbocapnine (CHEBI:3211) is a oxacycle (CHEBI:38104) |
| bulbocapnine (CHEBI:3211) is a phenols (CHEBI:33853) |
| bulbocapnine (CHEBI:3211) is conjugate base of bulbocapnine(1+) (CHEBI:134215) |
| Incoming Relation(s) |
| N-methylbulbocapnine(1+) (CHEBI:134217) has functional parent bulbocapnine (CHEBI:3211) |
| bulbocapnine(1+) (CHEBI:134215) is conjugate acid of bulbocapnine (CHEBI:3211) |
| IUPAC Name |
|---|
| (7aS)-11-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-12-ol |
| Manual Xrefs | Databases |
|---|---|
| Bulbocapnine | Wikipedia |
| C00001824 | KNApSAcK |
| C09367 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:94758 | Reaxys |
| CAS:298-45-3 | KEGG COMPOUND |
| CAS:298-45-3 | ChemIDplus |
| Citations |
|---|