EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO4 |
| Net Charge | 0 |
| Average Mass | 325.364 |
| Monoisotopic Mass | 325.13141 |
| SMILES | [H][C@]12Cc3ccc(OC)c(O)c3-c3c4c(cc(c31)CCN2C)OCO4 |
| InChI | InChI=1S/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | LODGIKWNLDQZBM-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.4.3.22 (diamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of diamine oxidase (EC 1.4.3.22). EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor An EC 1.14.16.* (oxidoreductase acting on paired donors, reduced pteridine as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosine 3-monooxygenase (EC 1.14.16.2). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bulbocapnine (CHEBI:3211) has functional parent aporphine (CHEBI:35643) |
| bulbocapnine (CHEBI:3211) has role EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor (CHEBI:63932) |
| bulbocapnine (CHEBI:3211) has role EC 1.4.3.22 (diamine oxidase) inhibitor (CHEBI:53659) |
| bulbocapnine (CHEBI:3211) has role plant metabolite (CHEBI:76924) |
| bulbocapnine (CHEBI:3211) is a aporphine alkaloid (CHEBI:134209) |
| bulbocapnine (CHEBI:3211) is a aromatic ether (CHEBI:35618) |
| bulbocapnine (CHEBI:3211) is a oxacycle (CHEBI:38104) |
| bulbocapnine (CHEBI:3211) is a phenols (CHEBI:33853) |
| bulbocapnine (CHEBI:3211) is conjugate base of bulbocapnine(1+) (CHEBI:134215) |
| Incoming Relation(s) |
| N-methylbulbocapnine(1+) (CHEBI:134217) has functional parent bulbocapnine (CHEBI:3211) |
| bulbocapnine(1+) (CHEBI:134215) is conjugate acid of bulbocapnine (CHEBI:3211) |
| IUPAC Name |
|---|
| (7aS)-11-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-12-ol |
| Manual Xrefs | Databases |
|---|---|
| C09367 | KEGG COMPOUND |
| Bulbocapnine | Wikipedia |
| C00001824 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:94758 | Reaxys |
| CAS:298-45-3 | KEGG COMPOUND |
| CAS:298-45-3 | ChemIDplus |
| Citations |
|---|