EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22NO4 |
| Net Charge | +1 |
| Average Mass | 340.399 |
| Monoisotopic Mass | 340.15433 |
| SMILES | [H][C@]12Cc3ccc(OC)c(O)c3-c3c4c(cc(c31)CC[N+]2(C)C)OCO4 |
| InChI | InChI=1S/C20H21NO4/c1-21(2)7-6-12-9-15-20(25-10-24-15)18-16(12)13(21)8-11-4-5-14(23-3)19(22)17(11)18/h4-5,9,13H,6-8,10H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | PQVMQKAGJGBKQC-ZDUSSCGKSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylbulbocapnine(1+) (CHEBI:134217) has functional parent bulbocapnine (CHEBI:3211) |
| N-methylbulbocapnine(1+) (CHEBI:134217) is a aporphine alkaloid (CHEBI:134209) |
| N-methylbulbocapnine(1+) (CHEBI:134217) is a quaternary ammonium ion (CHEBI:35267) |
| IUPAC Name |
|---|
| (7aS)-12-hydroxy-11-methoxy-7,7-dimethyl-6,7,7a,8-tetrahydro-2H,5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-7-ium |
| Synonym | Source |
|---|---|
| (S)-N-methylbulbocapnine(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-N-methylbulbocapnine | UniProt |
| Citations |
|---|