EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32034 - potassium bitartrate
| Formula | C4H5O6.K |
| Net Charge | 0 |
| Average Mass | 188.176 |
| Monoisotopic Mass | 187.97232 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)C(=O)O.[K+] |
| InChI | InChI=1S/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-1/t1-,2-;/m1./s1 |
| InChIKey | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. food stabiliser A food additive that is used to preserve the structure of food. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. |
| Applications: | raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. food stabiliser A food additive that is used to preserve the structure of food. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium bitartrate (CHEBI:32034) has part L-tartrate(1−) (CHEBI:35398) |
| potassium bitartrate (CHEBI:32034) has role antimicrobial agent (CHEBI:33281) |
| potassium bitartrate (CHEBI:32034) has role food acidity regulator (CHEBI:64049) |
| potassium bitartrate (CHEBI:32034) has role food anticaking agent (CHEBI:77965) |
| potassium bitartrate (CHEBI:32034) has role food humectant (CHEBI:77969) |
| potassium bitartrate (CHEBI:32034) has role food stabiliser (CHEBI:77966) |
| potassium bitartrate (CHEBI:32034) has role laxative (CHEBI:50503) |
| potassium bitartrate (CHEBI:32034) has role plant metabolite (CHEBI:76924) |
| potassium bitartrate (CHEBI:32034) has role raising agent (CHEBI:77971) |
| potassium bitartrate (CHEBI:32034) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate |
| Synonyms | Source |
|---|---|
| potassium hydrogen tartrate | ChemIDplus |
| potassium acid tartrate | ChemIDplus |
| potassium bitartrate | ChemIDplus |
| acid potassium tartrate | ChemIDplus |
| cream of tartar | ChemIDplus |
| monopotassium tartrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Faccla | ChemIDplus |
| Faccula | ChemIDplus |
| Faecula | ChemIDplus |
| Faecla | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01561 | KEGG DRUG |
| Potassium_bitartrate | Wikipedia |
| DB11107 | DrugBank |
| FDB016908 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:868-14-4 | ChemIDplus |
| Citations |
|---|