EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32034 - potassium bitartrate
| Formula | C4H5O6.K |
| Net Charge | 0 |
| Average Mass | 188.176 |
| Monoisotopic Mass | 187.97232 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)C(=O)O.[K+] |
| InChI | InChI=1S/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-1/t1-,2-;/m1./s1 |
| InChIKey | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. food stabiliser A food additive that is used to preserve the structure of food. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| Biological Roles: | food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. food stabiliser A food additive that is used to preserve the structure of food. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| Applications: | food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. food stabiliser A food additive that is used to preserve the structure of food. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium bitartrate (CHEBI:32034) has part L-tartrate(1−) (CHEBI:35398) |
| potassium bitartrate (CHEBI:32034) has role antimicrobial agent (CHEBI:33281) |
| potassium bitartrate (CHEBI:32034) has role food acidity regulator (CHEBI:64049) |
| potassium bitartrate (CHEBI:32034) has role food anticaking agent (CHEBI:77965) |
| potassium bitartrate (CHEBI:32034) has role food humectant (CHEBI:77969) |
| potassium bitartrate (CHEBI:32034) has role food stabiliser (CHEBI:77966) |
| potassium bitartrate (CHEBI:32034) has role laxative (CHEBI:50503) |
| potassium bitartrate (CHEBI:32034) has role plant metabolite (CHEBI:76924) |
| potassium bitartrate (CHEBI:32034) has role raising agent (CHEBI:77971) |
| potassium bitartrate (CHEBI:32034) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate |
| Synonyms | Source |
|---|---|
| acid potassium tartrate | ChemIDplus |
| cream of tartar | ChemIDplus |
| E-336(I) | ChEMBL |
| INS-336(I) | ChEMBL |
| INS NO.336(I) | ChEMBL |
| monopotassium tartrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Faccla | ChemIDplus |
| Faccula | ChemIDplus |
| Faecla | ChemIDplus |
| Faecula | ChemIDplus |
| Potassium bitartrate component of phexxi | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01561 | KEGG DRUG |
| DB11107 | DrugBank |
| FDB016908 | FooDB |
| Potassium_bitartrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:868-14-4 | ChemIDplus |
| Citations |
|---|