EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32034 - potassium bitartrate
| Formula | C4H5O6.K |
| Net Charge | 0 |
| Average Mass | 188.176 |
| Monoisotopic Mass | 187.97232 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)C(=O)O.[K+] |
| InChI | InChI=1S/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-1/t1-,2-;/m1./s1 |
| InChIKey | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. food stabiliser A food additive that is used to preserve the structure of food. food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. |
| Biological Roles: | food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. food stabiliser A food additive that is used to preserve the structure of food. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. |
| Applications: | food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. food stabiliser A food additive that is used to preserve the structure of food. food anticaking agent An anticaking agent that is used to reduced the tendency of particles of food to adhere to one another. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium bitartrate (CHEBI:32034) has part L-tartrate(1−) (CHEBI:35398) |
| potassium bitartrate (CHEBI:32034) has role antimicrobial agent (CHEBI:33281) |
| potassium bitartrate (CHEBI:32034) has role food acidity regulator (CHEBI:64049) |
| potassium bitartrate (CHEBI:32034) has role food anticaking agent (CHEBI:77965) |
| potassium bitartrate (CHEBI:32034) has role food humectant (CHEBI:77969) |
| potassium bitartrate (CHEBI:32034) has role food stabiliser (CHEBI:77966) |
| potassium bitartrate (CHEBI:32034) has role laxative (CHEBI:50503) |
| potassium bitartrate (CHEBI:32034) has role plant metabolite (CHEBI:76924) |
| potassium bitartrate (CHEBI:32034) has role raising agent (CHEBI:77971) |
| potassium bitartrate (CHEBI:32034) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate |
| Synonyms | Source |
|---|---|
| acid potassium tartrate | ChemIDplus |
| cream of tartar | ChemIDplus |
| E-336(I) | ChEMBL |
| INS-336(I) | ChEMBL |
| INS NO.336(I) | ChEMBL |
| monopotassium tartrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Faccla | ChemIDplus |
| Faccula | ChemIDplus |
| Faecla | ChemIDplus |
| Faecula | ChemIDplus |
| Potassium bitartrate component of phexxi | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01561 | KEGG DRUG |
| DB11107 | DrugBank |
| FDB016908 | FooDB |
| Potassium_bitartrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:868-14-4 | ChemIDplus |
| Citations |
|---|