EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N.HCl |
| Net Charge | 0 |
| Average Mass | 339.910 |
| Monoisotopic Mass | 339.17538 |
| SMILES | CCN1CCC(=C2c3ccccc3CCc3ccccc32)C1C.Cl |
| InChI | InChI=1S/C22H25N.ClH/c1-3-23-15-14-19(16(23)2)22-20-10-6-4-8-17(20)12-13-18-9-5-7-11-21(18)22;/h4-11,16H,3,12-15H2,1-2H3;1H |
| InChIKey | PLJNHZOEOXGWIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piroheptine hydrochloride (CHEBI:32018) has part piroheptine(1+) (CHEBI:176970) |
| piroheptine hydrochloride (CHEBI:32018) has role antiparkinson drug (CHEBI:48407) |
| piroheptine hydrochloride (CHEBI:32018) has role muscarinic antagonist (CHEBI:48876) |
| piroheptine hydrochloride (CHEBI:32018) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)-1-ethyl-2-methylpyrrolidine hydrochloride |
| Synonyms | Source |
|---|---|
| piroheptine HCl | ChemIDplus |
| 3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)-1-ethyl-2-methylpyrrolidinium chloride | IUPAC |
| Brand Name | Source |
|---|---|
| Trimol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01231 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:16378-22-6 | ChemIDplus |
| Citations |
|---|