EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N |
| Net Charge | +1 |
| Average Mass | 304.457 |
| Monoisotopic Mass | 304.20598 |
| SMILES | CC[NH+]1CCC(=C2c3ccccc3CCc3ccccc32)C1C |
| InChI | InChI=1S/C22H25N/c1-3-23-15-14-19(16(23)2)22-20-10-6-4-8-17(20)12-13-18-9-5-7-11-21(18)22/h4-11,16H,3,12-15H2,1-2H3/p+1 |
| InChIKey | NKJQZSDCCLDOQH-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piroheptine(1+) (CHEBI:176970) is a tertiary ammonium ion (CHEBI:137982) |
| piroheptine(1+) (CHEBI:176970) is conjugate acid of piroheptine (CHEBI:135287) |
| Incoming Relation(s) |
| piroheptine hydrochloride (CHEBI:32018) has part piroheptine(1+) (CHEBI:176970) |
| piroheptine (CHEBI:135287) is conjugate base of piroheptine(1+) (CHEBI:176970) |
| IUPAC Name |
|---|
| 3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)-1-ethyl-2-methylpyrrolidinium |
| Synonym | Source |
|---|---|
| piroheptine cation | ChEBI |