EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C18H20N2.Cl |
| Net Charge | 0 |
| Average Mass | 300.833 |
| Monoisotopic Mass | 300.13933 |
| SMILES | CN1CCN2c3ccccc3Cc3ccccc3C2C1.[Cl-].[H+] |
| InChI | InChI=1S/C18H20N2.ClH/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19;/h2-9,18H,10-13H2,1H3;1H |
| InChIKey | YNPFMWCWRVTGKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mianserin hydrochloride (CHEBI:31843) has part mianserin (CHEBI:51137) |
| mianserin hydrochloride (CHEBI:31843) has role geroprotector (CHEBI:176497) |
| mianserin hydrochloride (CHEBI:31843) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-methyl-1,2,3,4,10,14b-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine hydrochloride |
| Synonyms | Source |
|---|---|
| 1,2,3,4,10,14b-Hexahydro-2-methyldibenzo(c,f)pyrazino(1,2-a)azepine hydrochloride | ChemIDplus |
| 1,2,3,4,10,14b-Hexahydro-2-methyldibenzo(c,f)-pyrazino(1,2-a)azepine monohydrochloride | ChemIDplus |
| Dibenzo(c,f)pyrazino(1,2-a)azepine, 1,2,3,4,10,14b-hexahydro-2-methyl-, monohydrochloride | ChemIDplus |
| Mianserine hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101544644 | Patent |
| D01358 | KEGG DRUG |
| DB06148 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4280594 | Reaxys |
| CAS:21535-47-7 | ChemIDplus |
| Citations |
|---|