EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COC(=O)c1ccccc1O |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
| InChIKey | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl salicylate (CHEBI:31832) has functional parent salicylic acid (CHEBI:16914) |
| methyl salicylate (CHEBI:31832) has role flavouring agent (CHEBI:35617) |
| methyl salicylate (CHEBI:31832) has role insect attractant (CHEBI:24850) |
| methyl salicylate (CHEBI:31832) has role metabolite (CHEBI:25212) |
| methyl salicylate (CHEBI:31832) is a benzoate ester (CHEBI:36054) |
| methyl salicylate (CHEBI:31832) is a methyl ester (CHEBI:25248) |
| methyl salicylate (CHEBI:31832) is a salicylates (CHEBI:26596) |
| Synonyms | Source |
|---|---|
| Methyl 2-hydroxybenzoate | KEGG COMPOUND |
| Sweet birch oil | ChemIDplus |
| 2-(Methoxycarbonyl)phenol | ChemIDplus |
| Teaberry oil | ChemIDplus |
| 2-Hydroxybenzoic acid methyl ester | ChemIDplus |
| Spicewood Oil | ChemIDplus |
| UniProt Name | Source |
|---|---|
| methyl salicylate | UniProt |
| Citations |
|---|