EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31832 - methyl salicylate
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COC(=O)c1ccccc1O |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
| InChIKey | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | insect attractant A chemical that attracts insects. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. vulnerary A drug used in treating and healing of wounds. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl salicylate (CHEBI:31832) has functional parent salicylic acid (CHEBI:16914) |
| methyl salicylate (CHEBI:31832) has role analgesic (CHEBI:35480) |
| methyl salicylate (CHEBI:31832) has role anti-inflammatory agent (CHEBI:67079) |
| methyl salicylate (CHEBI:31832) has role flavouring agent (CHEBI:35617) |
| methyl salicylate (CHEBI:31832) has role insect attractant (CHEBI:24850) |
| methyl salicylate (CHEBI:31832) has role metabolite (CHEBI:25212) |
| methyl salicylate (CHEBI:31832) has role vulnerary (CHEBI:73336) |
| methyl salicylate (CHEBI:31832) is a benzoate ester (CHEBI:36054) |
| methyl salicylate (CHEBI:31832) is a methyl ester (CHEBI:25248) |
| methyl salicylate (CHEBI:31832) is a salicylates (CHEBI:26596) |
| Synonyms | Source |
|---|---|
| 2-Carbomethoxyphenol | ChemIDplus |
| 2-Hydroxybenzoic acid methyl ester | ChemIDplus |
| 2-(Methoxycarbonyl)phenol | ChemIDplus |
| Betula oil | ChemIDplus |
| Fema no. 2154 | ChEMBL |
| FEMA NO. 2745 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aspellin | ChEMBL |
| Balmosa | ChEMBL |
| Bengue's balsam | ChEMBL |
| Deep heat | ChEMBL |
| Dubam | ChEMBL |
| Gppe lin | ChEMBL |
| UniProt Name | Source |
|---|---|
| methyl salicylate | UniProt |
| Citations |
|---|