EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO.HCl |
| Net Charge | 0 |
| Average Mass | 215.724 |
| Monoisotopic Mass | 215.10769 |
| SMILES | CNC(C)Cc1ccccc1OC.Cl |
| InChI | InChI=1S/C11H17NO.ClH/c1-9(12-2)8-10-6-4-5-7-11(10)13-3;/h4-7,9,12H,8H2,1-3H3;1H |
| InChIKey | FGSJNNQVSUVTPW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxyphenamine hydrochloride (CHEBI:31830) has part methoxyphenamine (CHEBI:134817) |
| methoxyphenamine hydrochloride (CHEBI:31830) is a amphetamines (CHEBI:35338) |
| methoxyphenamine hydrochloride (CHEBI:31830) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(2-methoxyphenyl)-N-methylpropan-2-amine hydrochloride |
| Synonym | Source |
|---|---|
| α-(2-methoxyphenyl)-β-methylaminopropane hydrochloride | ChemIDplus |
| Citations |
|---|