EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:134817 - methoxyphenamine
| Formula | C11H17NO |
| Net Charge | 0 |
| Average Mass | 179.263 |
| Monoisotopic Mass | 179.13101 |
| SMILES | CNC(C)Cc1ccccc1OC |
| InChI | InChI=1S/C11H17NO/c1-9(12-2)8-10-6-4-5-7-11(10)13-3/h4-7,9,12H,8H2,1-3H3 |
| InChIKey | OEHAYUOVELTAPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxyphenamine (CHEBI:134817) has role bronchodilator agent (CHEBI:35523) |
| methoxyphenamine (CHEBI:134817) has role β-adrenergic agonist (CHEBI:35522) |
| methoxyphenamine (CHEBI:134817) is a amphetamines (CHEBI:35338) |
| Incoming Relation(s) |
| methoxyphenamine hydrochloride (CHEBI:31830) has part methoxyphenamine (CHEBI:134817) |
| IUPAC Name |
|---|
| 1-(2-methoxyphenyl)-N-methylpropan-2-amine |
| INNs | Source |
|---|---|
| methoxyphenamine | WHO MedNet |
| methoxyphenaminum | WHO MedNet |
| metoxifenamina | WHO MedNet |
| méthoxyphénamine | WHO MedNet |
| Synonyms | Source |
|---|---|
| methoxiphenadrin | DrugCentral |
| methoxyphenamin | DrugCentral |
| 2-Methoxymethamphetamine | DrugCentral |
| OMMA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1755 | DrugCentral |
| HMDB0041930 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2803353 | Reaxys |
| CAS:93-30-1 | DrugCentral |
| Citations |
|---|