EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17O3.2H2O.Na |
| Net Charge | 0 |
| Average Mass | 304.318 |
| Monoisotopic Mass | 304.12867 |
| SMILES | CC(C(=O)[O-])c1ccc(CC2CCCC2=O)cc1.O.O.[Na+] |
| InChI | InChI=1S/C15H18O3.Na.2H2O/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16;;;/h5-8,10,13H,2-4,9H2,1H3,(H,17,18);;2*1H2/q;+1;;/p-1 |
| InChIKey | BAZQYVYVKYOAGO-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxoprofen sodium hydrate (CHEBI:31786) has part loxoprofen sodium (CHEBI:76198) |
| loxoprofen sodium hydrate (CHEBI:31786) has role antipyretic (CHEBI:35493) |
| loxoprofen sodium hydrate (CHEBI:31786) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| loxoprofen sodium hydrate (CHEBI:31786) has role non-narcotic analgesic (CHEBI:35481) |
| loxoprofen sodium hydrate (CHEBI:31786) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| loxoprofen sodium hydrate (CHEBI:31786) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| sodium 2-{4-[(2-oxocyclopentyl)methyl]phenyl}propanoate—water (1/2) |
| Synonyms | Source |
|---|---|
| alpha-Methyl-4-((2-oxocyclopentyl)methyl)benzeneacetate sodium salt dihydrate | ChemIDplus |
| Loxoprofen | ChemIDplus |
| Loxoprofen sodium dihydrate | ChemIDplus |
| Sodium 2-(4-(2-oxocyclopentylmethyl)phenyl)propionate dihydrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01709 | KEGG DRUG |
| HMDB0041920 | HMDB |
| Loxoprofen | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5699005 | Reaxys |
| CAS:80382-23-6 | ChemIDplus |
| CAS:80382-23-6 | KEGG DRUG |
| Citations |
|---|