EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31653 - glafenine
| Formula | C19H17ClN2O4 |
| Net Charge | 0 |
| Average Mass | 372.808 |
| Monoisotopic Mass | 372.08768 |
| SMILES | O=C(OCC(O)CO)c1ccccc1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22) |
| InChIKey | GWOFUCIGLDBNKM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. inhibitor A substance that diminishes the rate of a chemical reaction. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glafenine (CHEBI:31653) has functional parent anthranilic acid (CHEBI:30754) |
| glafenine (CHEBI:31653) has functional parent glycerol (CHEBI:17754) |
| glafenine (CHEBI:31653) has role inhibitor (CHEBI:35222) |
| glafenine (CHEBI:31653) has role non-narcotic analgesic (CHEBI:35481) |
| glafenine (CHEBI:31653) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| glafenine (CHEBI:31653) is a aminoquinoline (CHEBI:36709) |
| glafenine (CHEBI:31653) is a carboxylic ester (CHEBI:33308) |
| glafenine (CHEBI:31653) is a glycol (CHEBI:13643) |
| glafenine (CHEBI:31653) is a organochlorine compound (CHEBI:36683) |
| glafenine (CHEBI:31653) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl 2-[(7-chloroquinolin-4-yl)amino]benzoate |
| INNs | Source |
|---|---|
| glafenine | KEGG DRUG |
| glafeninum | ChemIDplus |
| glafenina | ChemIDplus |
| glafénine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Glicafan | ChemIDplus |
| Glafenin | ChemIDplus |
| Glaphenine | ChemIDplus |
| Glifan | ChemIDplus |
| Glaphenin | ChemIDplus |
| 4-(2'-beta,gamma-Dihydroxypropoxycarbonylphenylamino)-7-chloroquinoline | ChemIDplus |
| Citations |
|---|