EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H73N15O11 |
| Net Charge | 0 |
| Average Mass | 1060.228 |
| Monoisotopic Mass | 1059.56140 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C50H73N15O11/c51-32(16-7-21-56-49(52)53)45(72)65-25-11-20-39(65)47(74)64-24-9-18-37(64)43(70)58-28-40(67)59-34(26-30-12-3-1-4-13-30)41(68)62-36(29-66)46(73)63-23-10-19-38(63)44(71)61-35(27-31-14-5-2-6-15-31)42(69)60-33(48(75)76)17-8-22-57-50(54)55/h1-6,12-15,32-39,66H,7-11,16-29,51H2,(H,58,70)(H,59,67)(H,60,69)(H,61,71)(H,62,68)(H,75,76)(H4,52,53,56)(H4,54,55,57)/t32-,33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| InChIKey | QXZGBUJJYSLZLT-FDISYFBBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bradykinin (CHEBI:3165) has role human blood serum metabolite (CHEBI:85234) |
| bradykinin (CHEBI:3165) has role vasodilator agent (CHEBI:35620) |
| bradykinin (CHEBI:3165) is a oligopeptide (CHEBI:25676) |
| bradykinin (CHEBI:3165) is conjugate base of bradykinin(2+) (CHEBI:132988) |
| Incoming Relation(s) |
| [Hyp3]-bradykinin (CHEBI:133051) has functional parent bradykinin (CHEBI:3165) |
| NPC-567 (CHEBI:73294) has functional parent bradykinin (CHEBI:3165) |
| bradykinin(2+) (CHEBI:132988) is conjugate acid of bradykinin (CHEBI:3165) |
| IUPAC Name |
|---|
| L-arginyl-L-prolyl-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-L-phenylalanyl-L-arginine |
| Synonyms | Source |
|---|---|
| Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg | ChEBI |
| BK | ChemIDplus |
| RPPGFSPFR | ChEBI |
| L-Arg-L-Pro-L-Pro-Gly-L-Phe-L-Ser-L-Pro-L-Phe-L-Arg | ChEBI |
| L-bradykinin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bradykinin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24162492 | Reaxys |
| Reaxys:2801232 | Reaxys |
| CAS:58-82-2 | ChemIDplus |
| Citations |
|---|