EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H73N15O12 |
| Net Charge | 0 |
| Average Mass | 1076.227 |
| Monoisotopic Mass | 1075.55631 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C50H73N15O12/c51-32(15-7-19-56-49(52)53)45(73)64-22-10-18-38(64)47(75)65-27-31(67)25-39(65)43(71)58-26-40(68)59-34(23-29-11-3-1-4-12-29)41(69)62-36(28-66)46(74)63-21-9-17-37(63)44(72)61-35(24-30-13-5-2-6-14-30)42(70)60-33(48(76)77)16-8-20-57-50(54)55/h1-6,11-14,31-39,66-67H,7-10,15-28,51H2,(H,58,71)(H,59,68)(H,60,70)(H,61,72)(H,62,69)(H,76,77)(H4,52,53,56)(H4,54,55,57)/t31-,32+,33+,34+,35+,36+,37+,38+,39+/m1/s1 |
| InChIKey | JXRLHZCEMXTCBN-DIBGMJQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2156727) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. bradykinin receptor agonist An agonist that binds to and activates bradykinin receptors hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [Hyp3]-bradykinin (CHEBI:133051) has functional parent bradykinin (CHEBI:3165) |
| [Hyp3]-bradykinin (CHEBI:133051) has role bradykinin receptor agonist (CHEBI:77495) |
| [Hyp3]-bradykinin (CHEBI:133051) has role human urinary metabolite (CHEBI:84087) |
| [Hyp3]-bradykinin (CHEBI:133051) is a oligopeptide (CHEBI:25676) |
| [Hyp3]-bradykinin (CHEBI:133051) is a peptide hormone (CHEBI:25905) |
| [Hyp3]-bradykinin (CHEBI:133051) is conjugate base of [Hyp3]-bradykinin(2+) (CHEBI:133054) |
| Incoming Relation(s) |
| [Hyp3]-bradykinin(2+) (CHEBI:133054) is conjugate acid of [Hyp3]-bradykinin (CHEBI:133051) |
| IUPAC Name |
|---|
| L-arginyl-L-prolyl-(4R)-4-hydroxy-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-L-phenylalanyl-L-arginine |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-pro-bradykinin | HMDB |
| 3-(L-4-Hydroxyproline)bradykinin | HMDB |
| Arg-3-hyp-bradykinin | ChemIDplus |
| Arg-Pro-Hyp-Gly-Phe-Ser-Pro-Phe-Arg | ChEBI |
| bradykinin hydroxy-pro(3) | ChEBI |
| Bradykinin, hydroxy-pro(3) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011728 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24161146 | Reaxys |
| Reaxys:8471700 | Reaxys |
| CAS:37642-65-2 | ChemIDplus |
| Citations |
|---|