EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H29GdN4O7 |
| Net Charge | 0 |
| Average Mass | 558.690 |
| Monoisotopic Mass | 559.12773 |
| SMILES | [H][O]1C(C)C[N]23CC[N]45CC[N]67CC[N]8(CC2)CC(=O)[O-][Gd+3]16483([O-]C(=O)C7)[O-]C(=O)C5 |
| InChI | InChI=1S/C17H32N4O7.Gd/c1-14(22)10-18-2-4-19(11-15(23)24)6-8-21(13-17(27)28)9-7-20(5-3-18)12-16(25)26;/h14,22H,2-13H2,1H3,(H,23,24)(H,25,26)(H,27,28);/q;+3/p-3 |
| InChIKey | DPNNNPAKRZOSMO-UHFFFAOYSA-K |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadoteridol (CHEBI:31643) has role antineoplastic agent (CHEBI:35610) |
| gadoteridol (CHEBI:31643) has role immunosuppressive agent (CHEBI:35705) |
| gadoteridol (CHEBI:31643) has role MRI contrast agent (CHEBI:37335) |
| gadoteridol (CHEBI:31643) is a gadolinium coordination entity (CHEBI:35730) |
| IUPAC Name |
|---|
| [2,2',2''-{10-[2-(hydroxy-κO)propyl]-1,4,7,10-tetraazacyclododecane-1,4,7-triyl-κ4N1,N4,N7,N10}triacetato-κO(3−)]gadolinium |
| INNs | Source |
|---|---|
| gadoteridol | KEGG DRUG |
| gadoteridolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| gadolinium 2,2',2''-[10-(2-hydroxypropyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl]triacetate | IUPAC |
| gadolinium-HP-DO3A | ChemIDplus |
| gadoteridol | ChemIDplus |
| Gd-HPDO3A | ChEBI |
| GD-HP-DO 3A | ChemIDplus |
| NSC-760055 | ChEMBL |
| Brand Names | Source |
|---|---|
| Prohance | ChEMBL |
| Prohance multipack | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01137 | KEGG DRUG |
| DB00597 | DrugBank |
| EP292689 | Patent |
| Gadoteridol | Wikipedia |
| US4885363 | Patent |
| Registry Numbers | Sources |
|---|---|
| Gmelin:897397 | Gmelin |
| CAS:120066-54-8 | ChemIDplus |
| Citations |
|---|