EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47F5O3S |
| Net Charge | 0 |
| Average Mass | 606.782 |
| Monoisotopic Mass | 606.31661 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3C[C@@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)[C@@]21[H] |
| InChI | InChI=1S/C32H47F5O3S/c1-30-17-15-26-25-12-11-24(38)21-23(25)20-22(29(26)27(30)13-14-28(30)39)10-7-5-3-2-4-6-8-18-41(40)19-9-16-31(33,34)32(35,36)37/h11-12,21-22,26-29,38-39H,2-10,13-20H2,1H3/t22-,26-,27+,28+,29-,30+,41?/m1/s1 |
| InChIKey | VWUXBMIQPBEWFH-WCCTWKNTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen receptor antagonist An antagonist at the estrogen receptor. estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. estrogen receptor antagonist An antagonist at the estrogen receptor. estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fulvestrant (CHEBI:31638) has parent hydride estrane (CHEBI:23966) |
| fulvestrant (CHEBI:31638) has role antineoplastic agent (CHEBI:35610) |
| fulvestrant (CHEBI:31638) has role estrogen antagonist (CHEBI:50837) |
| fulvestrant (CHEBI:31638) has role estrogen receptor antagonist (CHEBI:50792) |
| fulvestrant (CHEBI:31638) is a 17β-hydroxy steroid (CHEBI:35343) |
| fulvestrant (CHEBI:31638) is a 3-hydroxy steroid (CHEBI:36834) |
| fulvestrant (CHEBI:31638) is a organofluorine compound (CHEBI:37143) |
| fulvestrant (CHEBI:31638) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 7α-{9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl}estra-1(10),2,4-triene-3,17β-diol |
| INNs | Source |
|---|---|
| fulvestrant | KEGG DRUG |
| fulvestrantum | WHO MedNet |
| fulvestrant | WHO MedNet |
| fulvestrant | WHO MedNet |
| Synonyms | Source |
|---|---|
| ICI-182780 | ChemIDplus |
| ICI 182780 | ChemIDplus |
| (7α,17β)-7-{9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl}estra-1(10),2,4-triene-3,17-diol | IUPAC |
| Brand Name | Source |
|---|---|
| Faslodex | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01161 | KEGG DRUG |
| DB00947 | DrugBank |
| Fulvestrant | Wikipedia |
| LSM-6504 | LINCS |
| 1255 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:129453-61-8 | KEGG DRUG |
| CAS:129453-61-8 | ChemIDplus |
| Citations |
|---|