EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31630 - flutropium bromide
| Formula | Br.C24H29FNO3 |
| Net Charge | 0 |
| Average Mass | 478.402 |
| Monoisotopic Mass | 477.13148 |
| SMILES | [Br-].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)(c3ccccc3)c3ccccc3)C1)[N@+]2(C)CCF |
| InChI | InChI=1S/C24H29FNO3.BrH/c1-26(15-14-25)20-12-13-21(26)17-22(16-20)29-23(27)24(28,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,20-22,28H,12-17H2,1H3;1H/q+1;/p-1/t20-,21+,22+,26+; |
| InChIKey | FNUZASGZEHGWQM-RJRMRWARSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flutropium bromide (CHEBI:31630) has part flutropium (CHEBI:146214) |
| flutropium bromide (CHEBI:31630) has role anti-asthmatic drug (CHEBI:49167) |
| flutropium bromide (CHEBI:31630) has role antispasmodic drug (CHEBI:53784) |
| flutropium bromide (CHEBI:31630) has role muscarinic antagonist (CHEBI:48876) |
| flutropium bromide (CHEBI:31630) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-8-(2-fluoroethyl)-3-{[hydroxy(diphenyl)acetyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| bromure de flutropium | WHO MedNet |
| bromuro de flutropio | WHO MedNet |
| flutropii bromidum | WHO MedNet |
| flutropium bromide | WHO MedNet |
| Synonym | Source |
|---|---|
| Ba 598 BR | ChemIDplus |
| Brand Name | Source |
|---|---|
| Flubron | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:63516-07-4 | ChemIDplus |
| Citations |
|---|