EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C24H29FNO3 |
| Net Charge | 0 |
| Average Mass | 478.402 |
| Monoisotopic Mass | 477.13148 |
| SMILES | [Br-].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)(c3ccccc3)c3ccccc3)C1)[N@+]2(C)CCF |
| InChI | InChI=1S/C24H29FNO3.BrH/c1-26(15-14-25)20-12-13-21(26)17-22(16-20)29-23(27)24(28,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,20-22,28H,12-17H2,1H3;1H/q+1;/p-1/t20-,21+,22+,26+; |
| InChIKey | FNUZASGZEHGWQM-RJRMRWARSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flutropium bromide (CHEBI:31630) has part flutropium (CHEBI:146214) |
| flutropium bromide (CHEBI:31630) has role anti-asthmatic drug (CHEBI:49167) |
| flutropium bromide (CHEBI:31630) has role antispasmodic drug (CHEBI:53784) |
| flutropium bromide (CHEBI:31630) has role muscarinic antagonist (CHEBI:48876) |
| flutropium bromide (CHEBI:31630) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-8-(2-fluoroethyl)-3-{[hydroxy(diphenyl)acetyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| bromure de flutropium | WHO MedNet |
| bromuro de flutropio | WHO MedNet |
| flutropii bromidum | WHO MedNet |
| flutropium bromide | WHO MedNet |
| Synonym | Source |
|---|---|
| Ba 598 BR | ChemIDplus |
| Brand Name | Source |
|---|---|
| Flubron | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:63516-07-4 | ChemIDplus |
| Citations |
|---|