EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29FNO3 |
| Net Charge | +1 |
| Average Mass | 398.498 |
| Monoisotopic Mass | 398.21260 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)(c3ccccc3)c3ccccc3)C1)[N@+]2(C)CCF |
| InChI | InChI=1S/C24H29FNO3/c1-26(15-14-25)20-12-13-21(26)17-22(16-20)29-23(27)24(28,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20-22,28H,12-17H2,1H3/q+1/t20-,21+,22+,26+ |
| InChIKey | OATDVDIMNNZTEY-DAXLTYESSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flutropium (CHEBI:146214) has role anti-asthmatic drug (CHEBI:49167) |
| flutropium (CHEBI:146214) has role antispasmodic drug (CHEBI:53784) |
| flutropium (CHEBI:146214) has role muscarinic antagonist (CHEBI:48876) |
| flutropium (CHEBI:146214) is a azabicycloalkane (CHEBI:38295) |
| flutropium (CHEBI:146214) is a carboxylic ester (CHEBI:33308) |
| flutropium (CHEBI:146214) is a organofluorine compound (CHEBI:37143) |
| flutropium (CHEBI:146214) is a quaternary ammonium ion (CHEBI:35267) |
| flutropium (CHEBI:146214) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| flutropium bromide (CHEBI:31630) has part flutropium (CHEBI:146214) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-8-(2-fluoroethyl)-3-{[hydroxy(diphenyl)acetyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane |
| Synonyms | Source |
|---|---|
| flutropium cation | ChemIDplus |
| flutropium ion | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1228 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:754131-59-4 | ChemIDplus |
| Citations |
|---|