EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12FN3O3 |
| Net Charge | 0 |
| Average Mass | 313.288 |
| Monoisotopic Mass | 313.08627 |
| SMILES | CN1C(=O)CN=C(c2ccccc2F)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H,9H2,1H3 |
| InChIKey | PPTYJKAXVCCBDU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunitrazepam (CHEBI:31622) has role anxiolytic drug (CHEBI:35474) |
| flunitrazepam (CHEBI:31622) has role GABAA receptor agonist (CHEBI:91016) |
| flunitrazepam (CHEBI:31622) has role sedative (CHEBI:35717) |
| flunitrazepam (CHEBI:31622) is a C-nitro compound (CHEBI:35716) |
| flunitrazepam (CHEBI:31622) is a 1,4-benzodiazepinone (CHEBI:35500) |
| flunitrazepam (CHEBI:31622) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| 5-(2-fluorophenyl)-1-methyl-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| INNs | Source |
|---|---|
| flunitrazepam | WHO MedNet |
| flunitrazepam | WHO MedNet |
| flunitrazépam | WHO MedNet |
| flunitrazepamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,3-dihydro-5-(o-fluorophenyl)-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one | ChemIDplus |
| 1-methyl-7-nitro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2(1H)-one | ChemIDplus |
| 5-(o-fluorophenyl)-1,3-dihydro-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one | ChemIDplus |
| flunidazepam | DrugCentral |
| fluridrazepam | DrugCentral |
| N05CD03 | ChEMBL |
| Brand Names | Source |
|---|---|
| Fluninoc | ChemIDplus |
| Flunipam | ChemIDplus |
| Flunita | ChEBI |
| Fluscand | ChEBI |
| Hipnosedon | DrugBank |
| Hypnodorm | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1202 | DrugCentral |
| D01230 | KEGG DRUG |
| DB01544 | DrugBank |
| Flunitrazepam | Wikipedia |
| HMDB0015510 | HMDB |
| Citations |
|---|