EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12FN3O3 |
| Net Charge | 0 |
| Average Mass | 313.288 |
| Monoisotopic Mass | 313.08627 |
| SMILES | CN1C(=O)CN=C(c2ccccc2F)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H,9H2,1H3 |
| InChIKey | PPTYJKAXVCCBDU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunitrazepam (CHEBI:31622) has role anxiolytic drug (CHEBI:35474) |
| flunitrazepam (CHEBI:31622) has role GABAA receptor agonist (CHEBI:91016) |
| flunitrazepam (CHEBI:31622) has role sedative (CHEBI:35717) |
| flunitrazepam (CHEBI:31622) is a C-nitro compound (CHEBI:35716) |
| flunitrazepam (CHEBI:31622) is a 1,4-benzodiazepinone (CHEBI:35500) |
| flunitrazepam (CHEBI:31622) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| 5-(2-fluorophenyl)-1-methyl-7-nitro-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| INNs | Source |
|---|---|
| flunitrazepam | WHO MedNet |
| flunitrazepam | WHO MedNet |
| flunitrazépam | WHO MedNet |
| flunitrazepamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,3-dihydro-5-(o-fluorophenyl)-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one | ChemIDplus |
| 1-methyl-7-nitro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2(1H)-one | ChemIDplus |
| 5-(o-fluorophenyl)-1,3-dihydro-1-methyl-7-nitro-2H-1,4-benzodiazepin-2-one | ChemIDplus |
| flunidazepam | DrugCentral |
| fluridrazepam | DrugCentral |
| RO 5-4200 | DrugBank |
| Brand Names | Source |
|---|---|
| Fluninoc | ChemIDplus |
| Flunipam | ChemIDplus |
| Flunita | ChEBI |
| Fluscand | ChEBI |
| Hipnosedon | DrugBank |
| Hypnodorm | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1202 | DrugCentral |
| D01230 | KEGG DRUG |
| DB01544 | DrugBank |
| Flunitrazepam | Wikipedia |
| HMDB0015510 | HMDB |
| Citations |
|---|