EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 528.602 |
| Monoisotopic Mass | 528.24717 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28N2O.C6H8O7/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-12,21H,2,13-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | IVLVTNPOHDFFCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fentanyl citrate (CHEBI:31602) has part fentanyl (CHEBI:119915) |
| fentanyl citrate (CHEBI:31602) has role opioid analgesic (CHEBI:35482) |
| fentanyl citrate (CHEBI:31602) has role μ-opioid receptor agonist (CHEBI:55322) |
| fentanyl citrate (CHEBI:31602) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| N-(1-phenethyl-4-piperidinyl)propionanilide dihydrogen citrate | ChemIDplus |
| N-(1-phenethyl-4-piperidyl)propionanilide citrate | ChemIDplus |
| N-(1-phenethyl-4-piperidyl)propionanilide dihydrogen citrate | ChemIDplus |
| N-(1-phenethylpiperidin-4-yl)-N-phenylpropionamide citrate | ChEBI |
| N-phenyl-N-[1-(2-phenylethyl)-4-piperidyl]propanamide citrate | ChEBI |
| fentanyl citrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Abstral | ChemIDplus |
| Actiq | ChemIDplus |
| Fentora | ChemIDplus |
| Lazanda | ChemIDplus |
| Leptanal | ChemIDplus |
| Onsolis | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01399 | KEGG DRUG |
| DBSALT000301 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4121500 | Reaxys |
| CAS:990-73-8 | ChemIDplus |
| CAS:990-73-8 | KEGG DRUG |
| Citations |
|---|