EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O |
| Net Charge | 0 |
| Average Mass | 336.479 |
| Monoisotopic Mass | 336.22016 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3 |
| InChIKey | PJMPHNIQZUBGLI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. anaesthetic Substance which produces loss of feeling or sensation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fentanyl (CHEBI:119915) has role adjuvant (CHEBI:60809) |
| fentanyl (CHEBI:119915) has role anaesthesia adjuvant (CHEBI:60807) |
| fentanyl (CHEBI:119915) has role anaesthetic (CHEBI:38867) |
| fentanyl (CHEBI:119915) has role intravenous anaesthetic (CHEBI:38877) |
| fentanyl (CHEBI:119915) has role opioid analgesic (CHEBI:35482) |
| fentanyl (CHEBI:119915) has role μ-opioid receptor agonist (CHEBI:55322) |
| fentanyl (CHEBI:119915) is a anilide (CHEBI:13248) |
| fentanyl (CHEBI:119915) is a monocarboxylic acid amide (CHEBI:29347) |
| fentanyl (CHEBI:119915) is a piperidines (CHEBI:26151) |
| Incoming Relation(s) |
| fentanyl citrate (CHEBI:31602) has part fentanyl (CHEBI:119915) |
| IUPAC Name |
|---|
| N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| INNs | Source |
|---|---|
| fentanilo | WHO MedNet |
| fentanyl | WHO MedNet |
| fentanyl | WHO MedNet |
| fentanylum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-phenethyl-4-(N-phenylpropionamido)piperidine | ChemIDplus |
| 1-phenethyl-4-N-propionylanilinopiperidine | ChemIDplus |
| N-(1-phenethyl-4-piperidinyl)-N-phenylpropionamide | ChemIDplus |
| N-(1-phenethyl-4-piperidyl)propionanilide | ChemIDplus |
| N-(1-phenethyl-piperidin-4-yl)-N-phenyl-propionamide | ChEMBL |
| N-(1-phenethylpiperidin-4-yl)-N-phenylpropionamide | ChEMBL |
| Brand Name | Source |
|---|---|
| Duragesic | ChemIDplus |
| Citations |
|---|