EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4.HBr |
| Net Charge | 0 |
| Average Mass | 384.270 |
| Monoisotopic Mass | 383.07322 |
| SMILES | Br.CC(Cc1ccc(O)cc1)NCC(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H21NO4.BrH/c1-11(6-12-2-4-14(19)5-3-12)18-10-17(22)13-7-15(20)9-16(21)8-13;/h2-5,7-9,11,17-22H,6,10H2,1H3;1H |
| InChIKey | SGZRQMALQBXAIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoterol hydrobromide (CHEBI:31601) has part fenoterol (CHEBI:149226) |
| fenoterol hydrobromide (CHEBI:31601) has role bronchodilator agent (CHEBI:35523) |
| fenoterol hydrobromide (CHEBI:31601) has role sympathomimetic agent (CHEBI:35524) |
| fenoterol hydrobromide (CHEBI:31601) has role β-adrenergic agonist (CHEBI:35522) |
| fenoterol hydrobromide (CHEBI:31601) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| 5-(1-hydroxy-2-{[1-(4-hydroxyphenyl)propan-2-yl]amino}ethyl)benzene-1,3-diol hydrobromide |
| Synonyms | Source |
|---|---|
| fenoterol bromide | ChemIDplus |
| fenoterol HBr | ChEBI |
| phenoterol hydrobromide | ChemIDplus |