EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:149226 - fenoterol
| Formula | C17H21NO4 |
| Net Charge | 0 |
| Average Mass | 303.358 |
| Monoisotopic Mass | 303.14706 |
| SMILES | CC(Cc1ccc(O)cc1)NCC(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H21NO4/c1-11(6-12-2-4-14(19)5-3-12)18-10-17(22)13-7-15(20)9-16(21)8-13/h2-5,7-9,11,17-22H,6,10H2,1H3 |
| InChIKey | LSLYOANBFKQKPT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. tocolytic agent Any compound used to suppress premature labour and immature birth by suppressing uterine contractions. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoterol (CHEBI:149226) has role bronchodilator agent (CHEBI:35523) |
| fenoterol (CHEBI:149226) has role sympathomimetic agent (CHEBI:35524) |
| fenoterol (CHEBI:149226) has role tocolytic agent (CHEBI:66993) |
| fenoterol (CHEBI:149226) has role β-adrenergic agonist (CHEBI:35522) |
| fenoterol (CHEBI:149226) is a resorcinols (CHEBI:33572) |
| fenoterol (CHEBI:149226) is a secondary alcohol (CHEBI:35681) |
| fenoterol (CHEBI:149226) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| fenoterol hydrobromide (CHEBI:31601) has part fenoterol (CHEBI:149226) |
| IUPAC Name |
|---|
| 5-(1-hydroxy-2-{[1-(4-hydroxyphenyl)propan-2-yl]amino}ethyl)benzene-1,3-diol |
| INNs | Source |
|---|---|
| fenoterolum | ChemIDplus |
| fenoterol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-{1-Hydroxy-2-[2-(4-hydroxy-phenyl)-1-methyl-ethylamino]-ethyl}-benzene-1,3-diol | ChEMBL |
| 1-(3,5-dihydroxyphenyl)-1-hydroxy-2-((4-hydroxyphenyl)isopropylamino)ethane | ChemIDplus |
| 1-(p-hydroxyphenyl)-2-((β-hydroxy-β-(3',5'-dihydroxyphenyl))ethyl)aminopropane | ChemIDplus |
| 3,5-dihydroxy-α-(((p-hydroxy-α-methylphenethyl)amino)methyl)benzyl alcohol | ChemIDplus |
| phenoterol | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2157041 | Reaxys |
| CAS:13392-18-2 | KEGG DRUG |
| CAS:13392-18-2 | ChemIDplus |
| Citations |
|---|