EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31568 - profenamine hydrochloride
| Formula | C19H24N2S.HCl |
| Net Charge | 0 |
| Average Mass | 348.943 |
| Monoisotopic Mass | 348.14270 |
| SMILES | CCN(CC)C(C)CN1c2ccccc2Sc2ccccc21.Cl |
| InChI | InChI=1S/C19H24N2S.ClH/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21;/h6-13,15H,4-5,14H2,1-3H3;1H |
| InChIKey | VXPCQISYVPFYRK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| profenamine hydrochloride (CHEBI:31568) has part profenamine (CHEBI:313639) |
| profenamine hydrochloride (CHEBI:31568) has role adrenergic antagonist (CHEBI:37887) |
| profenamine hydrochloride (CHEBI:31568) has role antiparkinson drug (CHEBI:48407) |
| profenamine hydrochloride (CHEBI:31568) has role histamine antagonist (CHEBI:37956) |
| profenamine hydrochloride (CHEBI:31568) has role muscarinic antagonist (CHEBI:48876) |
| profenamine hydrochloride (CHEBI:31568) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N-diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 10-(2-(diethylamino)propyl)phenothiazine monohydrochloride | ChemIDplus |
| N,N-diethyl-α-methyl-10H-phenothiazine-10-ethylamine hydrochloride | ChEBI |
| N,N-diethyl-α-methyl-10H-phenothiazine-10-ethylamine monohydrochloride | ChemIDplus |
| ethopropazine HCl | ChemIDplus |
| ethopropazine hydrochloride | ChemIDplus |
| ethopropazine monohydrochloride | ChEBI |
| Citations |
|---|