EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:313639 - profenamine
| Formula | C19H24N2S |
| Net Charge | 0 |
| Average Mass | 312.482 |
| Monoisotopic Mass | 312.16602 |
| SMILES | CCN(CC)C(C)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3 |
| InChIKey | CDOZDBSBBXSXLB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. antiparkinson drug A drug used in the treatment of Parkinson's disease. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| profenamine (CHEBI:313639) has role adrenergic antagonist (CHEBI:37887) |
| profenamine (CHEBI:313639) has role antidyskinesia agent (CHEBI:66956) |
| profenamine (CHEBI:313639) has role antiparkinson drug (CHEBI:48407) |
| profenamine (CHEBI:313639) has role histamine antagonist (CHEBI:37956) |
| profenamine (CHEBI:313639) has role muscarinic antagonist (CHEBI:48876) |
| profenamine (CHEBI:313639) is a phenothiazines (CHEBI:38093) |
| profenamine (CHEBI:313639) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| profenamine hydrochloride (CHEBI:31568) has part profenamine (CHEBI:313639) |
| (R)-profenamine (CHEBI:60348) is a profenamine (CHEBI:313639) |
| (S)-profenamine (CHEBI:60349) is a profenamine (CHEBI:313639) |
| IUPAC Name |
|---|
| N,N-diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
| INNs | Source |
|---|---|
| profenamina | ChemIDplus |
| profenamine | ChemIDplus |
| profénamine | WHO MedNet |
| profenaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-[2-(diethylamino)-1-propyl]phenothiazine | NIST Chemistry WebBook |
| 10-[2-(diethylamino)-2-methylethyl]phenothiazine | NIST Chemistry WebBook |
| 10-(2-diethylaminopropyl)phenothiazine | ChemIDplus |
| 10-[2-(diethylamino)propyl]phenothiazine | NIST Chemistry WebBook |
| 2-diethylamino-1-propyl-N-dibenzoparathiazine | ChemIDplus |
| N,N-diethyl-1-(10H-phenothiazin-10-yl)-2-propanamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 1086 | DrugCentral |
| D08426 | KEGG DRUG |
| DB00392 | DrugBank |
| Ethopropazine | Wikipedia |
| HMDB0014536 | HMDB |
| LSM-1342 | LINCS |
| US2607773 | Patent |
| Citations |
|---|