EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO3S2 |
| Net Charge | 0 |
| Average Mass | 319.407 |
| Monoisotopic Mass | 319.03369 |
| SMILES | CC(/C=C1\SC(=S)N(CC(=O)O)C1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C15H13NO3S2/c1-10(7-11-5-3-2-4-6-11)8-12-14(19)16(9-13(17)18)15(20)21-12/h2-8H,9H2,1H3,(H,17,18)/b10-7+,12-8- |
| InChIKey | CHNUOJQWGUIOLD-NFZZJPOKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epalrestat (CHEBI:31539) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| epalrestat (CHEBI:31539) is a monocarboxylic acid (CHEBI:25384) |
| epalrestat (CHEBI:31539) is a thiazolidines (CHEBI:35622) |
| IUPAC Name |
|---|
| {(5Z)-5-[(2E)-2-methyl-3-phenylprop-2-en-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid |
| INNs | Source |
|---|---|
| epalrestat | WHO MedNet |
| epalrestatum | ChemIDplus |
| epalrestat | ChemIDplus |
| épalrestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-((1Z,2E)-2-methyl-3-phenylpropenylidene)-4-oxo-2-thioxo-3-thiazolidineacetic acid | ChemIDplus |
| 5-((Z,E)-β-methylcinnamylidene)-4-oxo-2-thioxo-3-thiazolidineacetic acid | ChemIDplus |
| Ono 2235 | ChemIDplus |
| ONO-2235 | ChEBI |
| ONO-2 | ChEBI |
| ONO 2 | ChEBI |
| Brand Name | Source |
|---|---|
| Kinedak | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4236712 | Reaxys |
| CAS:82159-09-9 | ChemIDplus |
| Citations |
|---|