EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32ClFO5 |
| Net Charge | 0 |
| Average Mass | 466.977 |
| Monoisotopic Mass | 466.19223 |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C25H32ClFO5/c1-5-21(31)32-25(20(30)13-26)14(2)10-18-17-7-6-15-11-16(28)8-9-22(15,3)24(17,27)19(29)12-23(18,25)4/h8-9,11,14,17-19,29H,5-7,10,12-13H2,1-4H3/t14-,17-,18-,19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | CBGUOGMQLZIXBE-XGQKBEPLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clobetasol propionate (CHEBI:31414) has functional parent clobetasol (CHEBI:205919) |
| clobetasol propionate (CHEBI:31414) has functional parent propionic acid (CHEBI:30768) |
| clobetasol propionate (CHEBI:31414) has role anti-inflammatory drug (CHEBI:35472) |
| clobetasol propionate (CHEBI:31414) is a 11β-hydroxy steroid (CHEBI:35346) |
| clobetasol propionate (CHEBI:31414) is a 20-oxo steroid (CHEBI:36885) |
| clobetasol propionate (CHEBI:31414) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| clobetasol propionate (CHEBI:31414) is a chlorinated steroid (CHEBI:77175) |
| clobetasol propionate (CHEBI:31414) is a fluorinated steroid (CHEBI:50830) |
| clobetasol propionate (CHEBI:31414) is a glucocorticoid (CHEBI:24261) |
| IUPAC Name |
|---|
| 21-chloro-9-fluoro-11β-hydroxy-16β-methyl-3,20-dioxopregna-1,4-dien-17-yl propanoate |
| Synonyms | Source |
|---|---|
| 21-chloro-9-fluoro-11β,17-dihydroxy-16β-methylpregna-1,4-diene-3,20-dione 17-propionate | ChemIDplus |
| clobetasol 17-propionate | ChemIDplus |
| clobetasol 17-propanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01272 | KEGG DRUG |
| DB01013 | DrugBank |
| Clobetasol | Wikipedia |
| 4452 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4769432 | Beilstein |
| CAS:25122-46-7 | KEGG DRUG |
| CAS:25122-46-7 | ChemIDplus |