EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32ClFO5 |
| Net Charge | 0 |
| Average Mass | 466.977 |
| Monoisotopic Mass | 466.19223 |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C25H32ClFO5/c1-5-21(31)32-25(20(30)13-26)14(2)10-18-17-7-6-15-11-16(28)8-9-22(15,3)24(17,27)19(29)12-23(18,25)4/h8-9,11,14,17-19,29H,5-7,10,12-13H2,1-4H3/t14-,17-,18-,19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | CBGUOGMQLZIXBE-XGQKBEPLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory drug A substance that reduces or suppresses inflammation. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antirheumatic drug A drug used to treat rheumatoid arthritis. antipsoriatic A drug used to treat psoriasis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clobetasol propionate (CHEBI:31414) has functional parent clobetasol (CHEBI:205919) |
| clobetasol propionate (CHEBI:31414) has functional parent propionic acid (CHEBI:30768) |
| clobetasol propionate (CHEBI:31414) has role anti-inflammatory drug (CHEBI:35472) |
| clobetasol propionate (CHEBI:31414) has role antineoplastic agent (CHEBI:35610) |
| clobetasol propionate (CHEBI:31414) has role antipsoriatic (CHEBI:50748) |
| clobetasol propionate (CHEBI:31414) has role antirheumatic drug (CHEBI:35842) |
| clobetasol propionate (CHEBI:31414) has role dermatologic drug (CHEBI:50177) |
| clobetasol propionate (CHEBI:31414) has role ophthalmology drug (CHEBI:66981) |
| clobetasol propionate (CHEBI:31414) is a 11β-hydroxy steroid (CHEBI:35346) |
| clobetasol propionate (CHEBI:31414) is a 20-oxo steroid (CHEBI:36885) |
| clobetasol propionate (CHEBI:31414) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| clobetasol propionate (CHEBI:31414) is a chlorinated steroid (CHEBI:77175) |
| clobetasol propionate (CHEBI:31414) is a fluorinated steroid (CHEBI:50830) |
| clobetasol propionate (CHEBI:31414) is a glucocorticoid (CHEBI:24261) |
| IUPAC Name |
|---|
| 21-chloro-9-fluoro-11β-hydroxy-16β-methyl-3,20-dioxopregna-1,4-dien-17-yl propanoate |
| Synonyms | Source |
|---|---|
| 21-chloro-9-fluoro-11β,17-dihydroxy-16β-methylpregna-1,4-diene-3,20-dione 17-propionate | ChemIDplus |
| CCI 4725 | ChEMBL |
| CCI-4725 | ChEMBL |
| Clobecort amex | ChEMBL |
| clobetasol 17-propanoate | ChEBI |
| clobetasol 17-propionate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Clarelux | ChEMBL |
| Clobaderm | ChEMBL |
| Clobetasol propionate (emollient) | ChEMBL |
| Clobex | ChEMBL |
| Cormax | ChEMBL |
| Dermovate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4452 | DrugCentral |
| Clobetasol | Wikipedia |
| D01272 | KEGG DRUG |
| DB01013 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4769432 | Beilstein |
| CAS:25122-46-7 | ChemIDplus |
| CAS:25122-46-7 | KEGG DRUG |
| Citations |
|---|