EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28ClFO4 |
| Net Charge | 0 |
| Average Mass | 410.913 |
| Monoisotopic Mass | 410.16602 |
| SMILES | [H][C@@]12C[C@H](C)[C@](O)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H28ClFO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/h6-7,9,12,15-17,26,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | FCSHDIVRCWTZOX-DVTGEIKXSA-N |
| Roles Classification |
|---|
| Biological Roles: | SMO receptor agonist An agonist that enhances the action of smoothened (SMO) receptor. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clobetasol (CHEBI:205919) has role anti-inflammatory drug (CHEBI:35472) |
| clobetasol (CHEBI:205919) has role SMO receptor agonist (CHEBI:131809) |
| clobetasol (CHEBI:205919) is a 11β-hydroxy steroid (CHEBI:35346) |
| clobetasol (CHEBI:205919) is a 17α-hydroxy steroid (CHEBI:35342) |
| clobetasol (CHEBI:205919) is a 20-oxo steroid (CHEBI:36885) |
| clobetasol (CHEBI:205919) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| clobetasol (CHEBI:205919) is a chlorinated steroid (CHEBI:77175) |
| clobetasol (CHEBI:205919) is a fluorinated steroid (CHEBI:50830) |
| clobetasol (CHEBI:205919) is a glucocorticoid (CHEBI:24261) |
| clobetasol (CHEBI:205919) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| clobetasol propionate (CHEBI:31414) has functional parent clobetasol (CHEBI:205919) |
| IUPAC Name |
|---|
| 21-chloro-9-fluoro-11β,17-dihydroxy-16β-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| clobetasol | ChemIDplus |
| clobetasolum | ChemIDplus |
| Synonym | Source |
|---|---|
| (11β,16β)-21-chloro-9-fluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6748271 | Beilstein |
| CAS:25122-41-2 | KEGG DRUG |
| CAS:25122-41-2 | ChemIDplus |
| Citations |
|---|