EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10BrClN4S |
| Net Charge | 0 |
| Average Mass | 393.697 |
| Monoisotopic Mass | 391.94981 |
| SMILES | Cc1nnc2n1-c1sc(Br)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C15H10BrClN4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)17)10-6-12(16)22-15(10)21(8)13/h2-6H,7H2,1H3 |
| InChIKey | UMSGKTJDUHERQW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). |
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. anticonvulsant A drug used to prevent seizures or reduce their severity. GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brotizolam (CHEBI:31308) has role anticonvulsant (CHEBI:35623) |
| brotizolam (CHEBI:31308) has role anxiolytic drug (CHEBI:35474) |
| brotizolam (CHEBI:31308) has role GABAA receptor agonist (CHEBI:91016) |
| brotizolam (CHEBI:31308) has role muscle relaxant (CHEBI:51371) |
| brotizolam (CHEBI:31308) has role sedative (CHEBI:35717) |
| brotizolam (CHEBI:31308) is a monochlorobenzenes (CHEBI:83403) |
| brotizolam (CHEBI:31308) is a organobromine compound (CHEBI:37141) |
| brotizolam (CHEBI:31308) is a thienotriazolodiazepine (CHEBI:84232) |
| IUPAC Name |
|---|
| 2-bromo-4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine |
| INNs | Source |
|---|---|
| brotizolam | WHO MedNet |
| brotizolam | WHO MedNet |
| brotizolam | WHO MedNet |
| brotizolamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| WE 941 | DrugBank |
| WE-941 | DrugBank |
| WE941 | ChEBI |
| WE 941-BS | DrugBank |
| WE 941BS | ChEBI |
| WE-941-BS | DrugBank |
| Brand Names | Source |
|---|---|
| Lendorm | ChEBI |
| Lendormin | KEGG DRUG |
| Mederantil | ChEBI |
| Sintonal | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 409 | DrugCentral |
| Brotizolam | Wikipedia |
| D01744 | KEGG DRUG |
| DB09017 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:57801-81-7 | NIST Chemistry WebBook |
| Citations |
|---|