EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37FO7 |
| Net Charge | 0 |
| Average Mass | 504.595 |
| Monoisotopic Mass | 504.25233 |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C28H37FO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1 |
| InChIKey | CIWBQSYVNNPZIQ-XYWKZLDCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antipsoriatic A drug used to treat psoriasis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betamethasone dipropionate (CHEBI:31276) has functional parent betamethasone (CHEBI:3077) |
| betamethasone dipropionate (CHEBI:31276) has role antifibrotic agent (CHEBI:233423) |
| betamethasone dipropionate (CHEBI:31276) has role antiinfective agent (CHEBI:35441) |
| betamethasone dipropionate (CHEBI:31276) has role antipsoriatic (CHEBI:50748) |
| betamethasone dipropionate (CHEBI:31276) has role dermatologic drug (CHEBI:50177) |
| betamethasone dipropionate (CHEBI:31276) has role gout suppressant (CHEBI:35845) |
| betamethasone dipropionate (CHEBI:31276) is a 11β-hydroxy steroid (CHEBI:35346) |
| betamethasone dipropionate (CHEBI:31276) is a 20-oxo steroid (CHEBI:36885) |
| betamethasone dipropionate (CHEBI:31276) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| betamethasone dipropionate (CHEBI:31276) is a fluorinated steroid (CHEBI:50830) |
| betamethasone dipropionate (CHEBI:31276) is a propanoate ester (CHEBI:36243) |
| betamethasone dipropionate (CHEBI:31276) is a steroid ester (CHEBI:47880) |
| Incoming Relation(s) |
| Enstilar (CHEBI:90855) has part betamethasone dipropionate (CHEBI:31276) |
| IUPAC Name |
|---|
| 9-fluoro-11β-hydroxy-16β-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl dipropanoate |
| Synonyms | Source |
|---|---|
| 9-Fluoro-11β,17,21-trihydroxy-16β-methylpregna-1,4-diene-3,20-dione-17,21-dipropionate | ChemIDplus |
| Betamethasone 17,21-dipropionate | ChemIDplus |
| Betamethasone (as dipropionate) | ChEMBL |
| Diprospan | ChEMBL |
| Maxivate | ChEMBL |
| NSC-758415 | ChEMBL |
| Brand Names | Source |
|---|---|
| Alphatrex | ChEMBL |
| Betamethasone dipropionate component of enstilar | ChEMBL |
| Betamethasone dipropionate component of leo-90100 | ChEMBL |
| Betamethasone dipropionate component of lotrisone | ChEMBL |
| Betamethasone dipropionate component of taclonex | ChEMBL |
| Betamethasone dipropionate component of wynzora | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 353 | DrugCentral |
| Betamethasone_Dipropionate | Wikipedia |
| D01637 | KEGG DRUG |
| DB00443 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3638108 | Reaxys |
| CAS:5593-20-4 | ChemIDplus |
| Citations |
|---|