EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O7S |
| Net Charge | 0 |
| Average Mass | 447.469 |
| Monoisotopic Mass | 447.11002 |
| SMILES | CCOC(=O)OC(C)OC1=C(C(=O)Nc2ccccn2)N(C)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H21N3O7S/c1-4-28-20(25)30-13(2)29-18-14-9-5-6-10-15(14)31(26,27)23(3)17(18)19(24)22-16-11-7-8-12-21-16/h5-13H,4H2,1-3H3,(H,21,22,24) |
| InChIKey | LSNWBKACGXCGAJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antirheumatic drug A drug used to treat rheumatoid arthritis. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ampiroxicam (CHEBI:31210) has functional parent piroxicam (CHEBI:8249) |
| ampiroxicam (CHEBI:31210) has role analgesic (CHEBI:35480) |
| ampiroxicam (CHEBI:31210) has role antirheumatic drug (CHEBI:35842) |
| ampiroxicam (CHEBI:31210) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| ampiroxicam (CHEBI:31210) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| ampiroxicam (CHEBI:31210) has role prodrug (CHEBI:50266) |
| ampiroxicam (CHEBI:31210) is a acetal (CHEBI:59769) |
| ampiroxicam (CHEBI:31210) is a aminopyridine (CHEBI:38207) |
| ampiroxicam (CHEBI:31210) is a benzothiazine (CHEBI:46899) |
| ampiroxicam (CHEBI:31210) is a etabonate ester (CHEBI:50850) |
| ampiroxicam (CHEBI:31210) is a monocarboxylic acid amide (CHEBI:29347) |
| ampiroxicam (CHEBI:31210) is a organic molecular entity (CHEBI:50860) |
| ampiroxicam (CHEBI:31210) is a racemate (CHEBI:60911) |
| ampiroxicam (CHEBI:31210) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| ethyl 1-{[2-methyl-1,1-dioxido-3-(pyridin-2-ylcarbamoyl)-2H-1,2-benzothiazin-4-yl]oxy}ethyl carbonate |
| INNs | Source |
|---|---|
| ampiroxicam | ChemIDplus |
| ampiroxicam | WHO MedNet |
| ampiroxicam | WHO MedNet |
| ampiroxicamum | ChemIDplus |
| Synonyms | Source |
|---|---|
| carbonic acid ethyl 1-({2-methyl-3-[(2-pyridinylamino)carbonyl]-2H-1,2-benzothiazin-4-yl}oxy)ethyl ester S,S-dioxide | ChemIDplus |
| CP 65703 | ChemIDplus |
| CP-65,703 | ChEMBL |
| CP-65703 | ChemIDplus |
| NSC-759807 | ChEMBL |
| Brand Name | Source |
|---|---|
| Flucam | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5184713 | Reaxys |
| CAS:99464-64-9 | KEGG DRUG |
| CAS:99464-64-9 | ChemIDplus |
| Citations |
|---|