EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO2 |
| Net Charge | 0 |
| Average Mass | 219.284 |
| Monoisotopic Mass | 219.12593 |
| SMILES | C=C(C)CNc1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO2/c1-9(2)8-14-12-6-4-11(5-7-12)10(3)13(15)16/h4-7,10,14H,1,8H2,2-3H3,(H,15,16) |
| InChIKey | FPHLBGOJWPEVME-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alminoprofen (CHEBI:31190) has role antipyretic (CHEBI:35493) |
| alminoprofen (CHEBI:31190) has role antirheumatic drug (CHEBI:35842) |
| alminoprofen (CHEBI:31190) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| alminoprofen (CHEBI:31190) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| alminoprofen (CHEBI:31190) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| alminoprofen (CHEBI:31190) has role non-narcotic analgesic (CHEBI:35481) |
| alminoprofen (CHEBI:31190) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| alminoprofen (CHEBI:31190) is a amino acid (CHEBI:33709) |
| alminoprofen (CHEBI:31190) is a monocarboxylic acid (CHEBI:25384) |
| alminoprofen (CHEBI:31190) is a secondary amino compound (CHEBI:50995) |
| alminoprofen (CHEBI:31190) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-{4-[(2-methylprop-2-en-1-yl)amino]phenyl}propanoic acid |
| INNs | Source |
|---|---|
| alminoprofen | ChemIDplus |
| alminoprofene | ChemIDplus |
| alminoprofeno | ChemIDplus |
| alminoprofenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-((2-Methylallyl)amino)phenyl)propansaeure | ChemIDplus |
| 2-{4-[(2-methylprop-2-en-1-yl)amino]phenyl}propionic acid | ChEBI |
| acide (methallylamino-4 phenyl)-2 propionique | ChemIDplus |
| BRN 2373633 | ChemIDplus |
| EB 382 | ChemIDplus |
| EB-382 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Minalfen | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 126 | DrugCentral |
| Alminoprofen | Wikipedia |
| D01513 | KEGG DRUG |
| FR2137211 | Patent |
| US3957850 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:39718-89-3 | ChemIDplus |
| CAS:39718-89-3 | KEGG DRUG |
| Citations |
|---|