EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37ClO7 |
| Net Charge | 0 |
| Average Mass | 521.050 |
| Monoisotopic Mass | 520.22278 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](OC(=O)CC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])[C@H](Cl)CC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C28H37ClO7/c1-6-22(33)35-14-21(32)28(36-23(34)7-2)15(3)10-18-24-19(29)12-16-11-17(30)8-9-26(16,4)25(24)20(31)13-27(18,28)5/h8-9,11,15,18-20,24-25,31H,6-7,10,12-14H2,1-5H3/t15-,18+,19-,20+,24-,25+,26+,27+,28+/m1/s1 |
| InChIKey | DJHCCTTVDRAMEH-DUUJBDRPSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alclometasone dipropionate (CHEBI:31184) has functional parent prednisolone (CHEBI:8378) |
| alclometasone dipropionate (CHEBI:31184) has role anti-inflammatory drug (CHEBI:35472) |
| alclometasone dipropionate (CHEBI:31184) is a 11β-hydroxy steroid (CHEBI:35346) |
| alclometasone dipropionate (CHEBI:31184) is a 20-oxo steroid (CHEBI:36885) |
| alclometasone dipropionate (CHEBI:31184) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| alclometasone dipropionate (CHEBI:31184) is a chlorinated steroid (CHEBI:77175) |
| alclometasone dipropionate (CHEBI:31184) is a glucocorticoid (CHEBI:24261) |
| alclometasone dipropionate (CHEBI:31184) is a propanoate ester (CHEBI:36243) |
| alclometasone dipropionate (CHEBI:31184) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| (7α,11β,16α)-7-chloro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl dipropanoate |
| Synonym | Source |
|---|---|
| Alclometasone dipropionate | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6493669 | Beilstein |
| CAS:66734-13-2 | ChemIDplus |
| CAS:66734-13-2 | KEGG DRUG |
| CAS:66734-13-2 | DrugBank |