EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37ClO7 |
| Net Charge | 0 |
| Average Mass | 521.050 |
| Monoisotopic Mass | 520.22278 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](OC(=O)CC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])[C@H](Cl)CC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C28H37ClO7/c1-6-22(33)35-14-21(32)28(36-23(34)7-2)15(3)10-18-24-19(29)12-16-11-17(30)8-9-26(16,4)25(24)20(31)13-27(18,28)5/h8-9,11,15,18-20,24-25,31H,6-7,10,12-14H2,1-5H3/t15-,18+,19-,20+,24-,25+,26+,27+,28+/m1/s1 |
| InChIKey | DJHCCTTVDRAMEH-DUUJBDRPSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-inflammatory drug A substance that reduces or suppresses inflammation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alclometasone dipropionate (CHEBI:31184) has functional parent prednisolone (CHEBI:8378) |
| alclometasone dipropionate (CHEBI:31184) has role anti-inflammatory drug (CHEBI:35472) |
| alclometasone dipropionate (CHEBI:31184) has role antineoplastic agent (CHEBI:35610) |
| alclometasone dipropionate (CHEBI:31184) has role ophthalmology drug (CHEBI:66981) |
| alclometasone dipropionate (CHEBI:31184) is a 11β-hydroxy steroid (CHEBI:35346) |
| alclometasone dipropionate (CHEBI:31184) is a 20-oxo steroid (CHEBI:36885) |
| alclometasone dipropionate (CHEBI:31184) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| alclometasone dipropionate (CHEBI:31184) is a chlorinated steroid (CHEBI:77175) |
| alclometasone dipropionate (CHEBI:31184) is a glucocorticoid (CHEBI:24261) |
| alclometasone dipropionate (CHEBI:31184) is a propanoate ester (CHEBI:36243) |
| alclometasone dipropionate (CHEBI:31184) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| (7α,11β,16α)-7-chloro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl dipropanoate |
| INN | Source |
|---|---|
| alclometasona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Alclometasone 17,21-dipropionate | ChEMBL |
| Alclometasone dipropionate | KEGG DRUG |
| NSC-758914 | ChEMBL |
| SCH 22219 | ChEMBL |
| SCH-22219 | ChEMBL |
| Brand Name | Source |
|---|---|
| Modrasone | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6493669 | Beilstein |
| CAS:66734-13-2 | DrugBank |
| CAS:66734-13-2 | ChemIDplus |
| CAS:66734-13-2 | KEGG DRUG |
| Citations |
|---|