EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13Cl2NO4 |
| Net Charge | 0 |
| Average Mass | 354.189 |
| Monoisotopic Mass | 353.02216 |
| SMILES | O=C(O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO4/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21/h1-7,19H,8-9H2,(H,20,21) |
| InChIKey | MNIPYSSQXLZQLJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aceclofenac (CHEBI:31159) has functional parent diclofenac (CHEBI:47381) |
| aceclofenac (CHEBI:31159) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| aceclofenac (CHEBI:31159) has role non-narcotic analgesic (CHEBI:35481) |
| aceclofenac (CHEBI:31159) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| aceclofenac (CHEBI:31159) is a amino acid (CHEBI:33709) |
| aceclofenac (CHEBI:31159) is a carboxylic ester (CHEBI:33308) |
| aceclofenac (CHEBI:31159) is a dichlorobenzene (CHEBI:23697) |
| aceclofenac (CHEBI:31159) is a monocarboxylic acid (CHEBI:25384) |
| aceclofenac (CHEBI:31159) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (2-{2-[(2,6-dichlorophenyl)amino]phenyl}acetoxy)acetic acid |
| INNs | Source |
|---|---|
| aceclofenac | ChemIDplus |
| acéclofénac | WHO MedNet |
| aceclofenaco | ChemIDplus |
| aceclofenacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid carboxymethyl ester | ChEBI |
| 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetic acid | ChEBI |
| 2-[(2',6'-dichlorophenyl)amino]phenylacetoxyacetic acid | ChEBI |
| glycolic acid [o-(2,6-dichloroanilino)phenyl]acetate ester | ChEBI |
| PR-82/3 | ChEBI |
| Brand Names | Source |
|---|---|
| Cincofen | ChEBI |
| Clanza | ChEBI |
| Hifenac | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4884476 | Reaxys |
| CAS:89796-99-6 | ChemIDplus |
| CAS:89796-99-6 | KEGG DRUG |
| Citations |
|---|