EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)12-8-21-14-7-10(17)6-13(18)15(14)16(12)19/h2-8,17-18H,1H3 |
| InChIKey | WUADCCWRTIWANL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of fatty acid amide hydrolase (EC 3.5.1.99). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biochanin A (CHEBI:17574) has role antineoplastic agent (CHEBI:35610) |
| biochanin A (CHEBI:17574) has role EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor (CHEBI:64033) |
| biochanin A (CHEBI:17574) has role phytoestrogen (CHEBI:76989) |
| biochanin A (CHEBI:17574) has role plant metabolite (CHEBI:76924) |
| biochanin A (CHEBI:17574) has role tyrosine kinase inhibitor (CHEBI:38637) |
| biochanin A (CHEBI:17574) is a 4'-methoxyisoflavones (CHEBI:133959) |
| biochanin A (CHEBI:17574) is a 7-hydroxyisoflavones (CHEBI:55465) |
| biochanin A (CHEBI:17574) is conjugate acid of biochanin A(1−) (CHEBI:58194) |
| Incoming Relation(s) |
| 2,3-dihydrobiochanin A (CHEBI:15712) has functional parent biochanin A (CHEBI:17574) |
| biochanin A 7-O-(6-O-malonyl-β-D-glucoside) (CHEBI:28556) has functional parent biochanin A (CHEBI:17574) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) has functional parent biochanin A (CHEBI:17574) |
| biochanin A(1−) (CHEBI:58194) is conjugate base of biochanin A (CHEBI:17574) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4'-methylgenistein | ChemIDplus |
| 5,7-dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| 5,7-dihydroxy-3-p-methoxyphenyl-4H-chromen-4-one | ChemIDplus |
| 5,7-dihydroxy-4'-methoxyisoflavone | ChemIDplus |
| Biochanin A | KEGG COMPOUND |
| olmelin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Biochanin_A | Wikipedia |
| BIOCHANIN-A | MetaCyc |
| C00002510 | KNApSAcK |
| C00814 | KEGG COMPOUND |
| HMDB0002338 | HMDB |
| LMPK12050229 | LIPID MAPS |
| QSO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:278107 | Reaxys |
| CAS:491-80-5 | KEGG COMPOUND |
| CAS:491-80-5 | ChemIDplus |
| Citations |
|---|