EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)12-8-21-14-7-10(17)6-13(18)15(14)16(12)19/h2-8,17-18H,1H3 |
| InChIKey | WUADCCWRTIWANL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of fatty acid amide hydrolase (EC 3.5.1.99). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biochanin A (CHEBI:17574) has role antineoplastic agent (CHEBI:35610) |
| biochanin A (CHEBI:17574) has role EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor (CHEBI:64033) |
| biochanin A (CHEBI:17574) has role phytoestrogen (CHEBI:76989) |
| biochanin A (CHEBI:17574) has role plant metabolite (CHEBI:76924) |
| biochanin A (CHEBI:17574) has role tyrosine kinase inhibitor (CHEBI:38637) |
| biochanin A (CHEBI:17574) is a 4'-methoxyisoflavones (CHEBI:133959) |
| biochanin A (CHEBI:17574) is a 7-hydroxyisoflavones (CHEBI:55465) |
| biochanin A (CHEBI:17574) is conjugate acid of biochanin A(1−) (CHEBI:58194) |
| Incoming Relation(s) |
| 2,3-dihydrobiochanin A (CHEBI:15712) has functional parent biochanin A (CHEBI:17574) |
| biochanin A 7-O-(6-O-malonyl-β-D-glucoside) (CHEBI:28556) has functional parent biochanin A (CHEBI:17574) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) has functional parent biochanin A (CHEBI:17574) |
| biochanin A(1−) (CHEBI:58194) is conjugate base of biochanin A (CHEBI:17574) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4'-methylgenistein | ChemIDplus |
| 5,7-dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| 5,7-dihydroxy-3-p-methoxyphenyl-4H-chromen-4-one | ChemIDplus |
| 5,7-dihydroxy-4'-methoxyisoflavone | ChemIDplus |
| Biochanin A | KEGG COMPOUND |
| olmelin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Biochanin_A | Wikipedia |
| BIOCHANIN-A | MetaCyc |
| C00002510 | KNApSAcK |
| C00814 | KEGG COMPOUND |
| HMDB0002338 | HMDB |
| LMPK12050229 | LIPID MAPS |
| QSO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:278107 | Reaxys |
| CAS:491-80-5 | KEGG COMPOUND |
| CAS:491-80-5 | ChemIDplus |
| Citations |
|---|