EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N2O2 |
| Net Charge | 0 |
| Average Mass | 138.126 |
| Monoisotopic Mass | 138.04293 |
| SMILES | O=C(O)/C=C\c1cncn1 |
| InChI | InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1- |
| InChIKey | LOIYMIARKYCTBW-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chromophore The part (atom or group of atoms) of a molecular entity in which the electronic transition responsible for a given spectral band is approximately localized. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-urocanic acid (CHEBI:30818) is a urocanic acid (CHEBI:27248) |
| cis-urocanic acid (CHEBI:30818) is conjugate acid of cis-urocanate (CHEBI:30819) |
| Incoming Relation(s) |
| cis-urocanate (CHEBI:30819) is conjugate base of cis-urocanic acid (CHEBI:30818) |
| IUPAC Name |
|---|
| (2Z)-3-(1H-imidazol-4-yl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| cis-urocanic acid | ChemIDplus |
| (Z)-imidazole-4-acrylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:81404 | Beilstein |
| CAS:7699-35-6 | ChemIDplus |