EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O10 |
| Net Charge | 0 |
| Average Mass | 376.358 |
| Monoisotopic Mass | 376.13695 |
| SMILES | [H][C@]12[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)O)[C@@]1([H])C[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C16H24O10/c1-5-8(18)2-6-7(14(22)23)4-24-15(10(5)6)26-16-13(21)12(20)11(19)9(3-17)25-16/h4-6,8-13,15-21H,2-3H2,1H3,(H,22,23)/t5-,6+,8-,9+,10+,11+,12-,13+,15-,16-/m0/s1 |
| InChIKey | JNNGEAWILNVFFD-CDJYTOATSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loganic acid (CHEBI:30632) has role plant metabolite (CHEBI:76924) |
| loganic acid (CHEBI:30632) is a cyclopentapyran (CHEBI:38606) |
| loganic acid (CHEBI:30632) is a glucoside (CHEBI:24278) |
| loganic acid (CHEBI:30632) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| loganic acid (CHEBI:30632) is conjugate acid of loganate (CHEBI:18052) |
| Incoming Relation(s) |
| loganate (CHEBI:18052) is conjugate base of loganic acid (CHEBI:30632) |
| IUPAC Name |
|---|
| (1S,4aS,6S,7R,7aS)-1-(β-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| Synonym | Source |
|---|---|
| Loganic acid | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4887090 | Beilstein |
| CAS:22255-40-9 | KEGG COMPOUND |
| CAS:22255-40-9 | ChemIDplus |