EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3049 - benzatropine mesylate
| Formula | C21H26NO.CH3O3S |
| Net Charge | 0 |
| Average Mass | 403.544 |
| Monoisotopic Mass | 403.18173 |
| SMILES | CS(=O)(=O)[O-].[H][C@@]1(OC(c2ccccc2)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)[NH+]2C |
| InChI | InChI=1S/C21H25NO.CH4O3S/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-5(2,3)4/h2-11,18-21H,12-15H2,1H3;1H3,(H,2,3,4)/t18-,19+,20+; |
| InChIKey | CPFJLLXFNPCTDW-BWSPSPBFSA-N |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzatropine mesylate (CHEBI:3049) has part benzatropine (CHEBI:3048) |
| benzatropine mesylate (CHEBI:3049) has role anticoronaviral agent (CHEBI:149553) |
| benzatropine mesylate (CHEBI:3049) has role antiparkinson drug (CHEBI:48407) |
| benzatropine mesylate (CHEBI:3049) has role parasympatholytic (CHEBI:50370) |
| benzatropine mesylate (CHEBI:3049) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane methanesulfonate |
| Synonyms | Source |
|---|---|
| 3-diphenylmethoxytropane mesylate | ChemIDplus |
| 3-diphenylmethoxytropane methanesulfonate | ChemIDplus |
| (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azoniabicyclo[3.2.1]octane methanesulfonate | IUPAC |
| 3endo-benzhydryloxytropane mesylate | ChEBI |
| 3endo-benzhydryloxytropane methanesulphonate | ChEBI |
| 3α-(diphenylmethoxy)-1αH,5αH-tropane mesylate | ChEBI |