EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3049 - benzatropine mesylate
| Formula | C21H26NO.CH3O3S |
| Net Charge | 0 |
| Average Mass | 403.544 |
| Monoisotopic Mass | 403.18173 |
| SMILES | CS(=O)(=O)[O-].[H][C@@]1(OC(c2ccccc2)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)[NH+]2C |
| InChI | InChI=1S/C21H25NO.CH4O3S/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-5(2,3)4/h2-11,18-21H,12-15H2,1H3;1H3,(H,2,3,4)/t18-,19+,20+; |
| InChIKey | CPFJLLXFNPCTDW-BWSPSPBFSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzatropine mesylate (CHEBI:3049) has part benzatropine (CHEBI:3048) |
| benzatropine mesylate (CHEBI:3049) has role anticoronaviral agent (CHEBI:149553) |
| benzatropine mesylate (CHEBI:3049) has role antiparkinson drug (CHEBI:48407) |
| benzatropine mesylate (CHEBI:3049) has role parasympatholytic (CHEBI:50370) |
| benzatropine mesylate (CHEBI:3049) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane methanesulfonate |
| Synonyms | Source |
|---|---|
| benztropine mesilate | KEGG DRUG |
| benztropine mesylate | KEGG DRUG |
| benzatropine methanesulfonate | ChemIDplus |
| 3-diphenylmethoxytropane mesylate | ChemIDplus |
| 3-diphenylmethoxytropane methanesulfonate | ChemIDplus |
| benztropine methanesulfonate | ChEBI |