EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3048 - benzatropine
| Formula | C21H25NO |
| Net Charge | 0 |
| Average Mass | 307.437 |
| Monoisotopic Mass | 307.19361 |
| SMILES | [H][C@@]1(OC(c2ccccc2)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)N2C |
| InChI | InChI=1S/C21H25NO/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-21H,12-15H2,1H3/t18-,19+,20+ |
| InChIKey | GIJXKZJWITVLHI-PMOLBWCYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | oneirogen Any substance that produces or enhances dream-like states of consciousness. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzatropine (CHEBI:3048) has role antidyskinesia agent (CHEBI:66956) |
| benzatropine (CHEBI:3048) has role antiparkinson drug (CHEBI:48407) |
| benzatropine (CHEBI:3048) has role muscarinic antagonist (CHEBI:48876) |
| benzatropine (CHEBI:3048) has role oneirogen (CHEBI:146270) |
| benzatropine (CHEBI:3048) has role parasympatholytic (CHEBI:50370) |
| benzatropine (CHEBI:3048) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| benzatropine mesylate (CHEBI:3049) has part benzatropine (CHEBI:3048) |
| IUPAC Name |
|---|
| (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane |
| INNs | Source |
|---|---|
| benzatropina | ChemIDplus |
| benzatropine | KEGG DRUG |
| benzatropinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3endo-benzhydryloxytropane | ChEBI |
| 3α-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane | ChEBI |
| 3α-(diphenylmethoxy)-1αH,5αH-tropane | NIST Chemistry WebBook |
| 3α-(diphenylmethoxy)tropane | ChEBI |
| Benzatropine | KEGG COMPOUND |
| benzhydryl 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ether | NIST Chemistry WebBook |