EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10 |
| Net Charge | 0 |
| Average Mass | 58.124 |
| Monoisotopic Mass | 58.07825 |
| SMILES | CC(C)C |
| InChI | InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 |
| InChIKey | NNPPMTNAJDCUHE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food propellant A propellant that is used to expel foods from an aerosol container. |
| Biological Role: | food propellant A propellant that is used to expel foods from an aerosol container. |
| Applications: | food propellant A propellant that is used to expel foods from an aerosol container. refrigerant A substance used in a thermodynamic heat pump cycle or refrigeration cycle that undergoes a phase change from a gas to a liquid and back. Refrigerants are used in air-conditioning systems and freezers or refrigerators and are assigned a "R" number (by ASHRAE - formerly the American Society of Heating, Refrigerating and Air Conditioning Engineers), which is determined systematically according to their molecular structure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobutane (CHEBI:30363) has role food propellant (CHEBI:78017) |
| isobutane (CHEBI:30363) has role refrigerant (CHEBI:78433) |
| isobutane (CHEBI:30363) is a alkane (CHEBI:18310) |
| isobutane (CHEBI:30363) is a gas molecular entity (CHEBI:138675) |
| Incoming Relation(s) |
| tert-butanol (CHEBI:45895) has parent hydride isobutane (CHEBI:30363) |
| 2-hydroxy-2-methylpropanal (CHEBI:131846) has parent hydride isobutane (CHEBI:30363) |
| 2-methylpropane-1,2-diol (CHEBI:131845) has parent hydride isobutane (CHEBI:30363) |
| isobutanol (CHEBI:46645) has parent hydride isobutane (CHEBI:30363) |
| tert-butyl group (CHEBI:30355) is substituent group from isobutane (CHEBI:30363) |
| isobutyl group (CHEBI:30356) is substituent group from isobutane (CHEBI:30363) |
| IUPAC Names |
|---|
| 2-methylpropane |
| isobutane |
| Synonyms | Source |
|---|---|
| (CH3)2CH‒CH3 | IUPAC |
| E943b | ChEBI |
| R-600a | ChEBI |
| Citations |
|---|