EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N4O7S |
| Net Charge | 0 |
| Average Mass | 410.408 |
| Monoisotopic Mass | 410.08962 |
| SMILES | COC(=O)c1ccccc1CS(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C16H18N4O7S/c1-25-12-8-13(26-2)18-15(17-12)19-16(22)20-28(23,24)9-10-6-4-5-7-11(10)14(21)27-3/h4-8H,9H2,1-3H3,(H2,17,18,19,20,22) |
| InChIKey | XMQFTWRPUQYINF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bensulfuron-methyl (CHEBI:3017) has functional parent bensulfuron (CHEBI:132880) |
| bensulfuron-methyl (CHEBI:3017) has role agrochemical (CHEBI:33286) |
| bensulfuron-methyl (CHEBI:3017) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| bensulfuron-methyl (CHEBI:3017) has role herbicide (CHEBI:24527) |
| bensulfuron-methyl (CHEBI:3017) is a N-sulfonylurea (CHEBI:76983) |
| bensulfuron-methyl (CHEBI:3017) is a aromatic ether (CHEBI:35618) |
| bensulfuron-methyl (CHEBI:3017) is a methyl ester (CHEBI:25248) |
| bensulfuron-methyl (CHEBI:3017) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| methyl 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}methyl)benzoate |
| Synonyms | Source |
|---|---|
| Bensulfuron methyl | KEGG COMPOUND |
| bensulfuron methyl ester | ChemIDplus |
| methyl 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]benzoate | Alan Wood's Pesticides |
| Methyl bensulfuron | KEGG COMPOUND |
| methyl α-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-o-toluate | Alan Wood's Pesticides |
| methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulfonyl)-o-toluate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 60G | PDBeChem |
| 68 | PPDB |
| C10937 | KEGG COMPOUND |
| derivatives/bensulfuron-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7447488 | Reaxys |
| CAS:83055-99-6 | ChemIDplus |
| CAS:83055-99-6 | Alan Wood's Pesticides |
| CAS:83055-99-6 | KEGG COMPOUND |
| Citations |
|---|