EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4O7S |
| Net Charge | 0 |
| Average Mass | 396.381 |
| Monoisotopic Mass | 396.07397 |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)Cc2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C15H16N4O7S/c1-25-11-7-12(26-2)17-14(16-11)18-15(22)19-27(23,24)8-9-5-3-4-6-10(9)13(20)21/h3-7H,8H2,1-2H3,(H,20,21)(H2,16,17,18,19,22) |
| InChIKey | PPWBRCCBKOWDNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bensulfuron (CHEBI:132880) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| bensulfuron (CHEBI:132880) has role herbicide (CHEBI:24527) |
| bensulfuron (CHEBI:132880) is a N-sulfonylurea (CHEBI:76983) |
| bensulfuron (CHEBI:132880) is a aromatic ether (CHEBI:35618) |
| bensulfuron (CHEBI:132880) is a benzoic acids (CHEBI:22723) |
| bensulfuron (CHEBI:132880) is a pyrimidines (CHEBI:39447) |
| Incoming Relation(s) |
| bensulfuron-methyl (CHEBI:3017) has functional parent bensulfuron (CHEBI:132880) |
| IUPAC Name |
|---|
| 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}methyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]methyl]benzoic acid | Alan Wood's Pesticides |
| α-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-o-toluic acid | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 1552 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8397287 | Reaxys |
| CAS:99283-01-9 | ChemIDplus |
| CAS:99283-01-9 | Alan Wood's Pesticides |
| Citations |
|---|