EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | [H][C@]1(C(C)(C)O)CC=C(C)CC1 |
| InChI | InChI=1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | WUOACPNHFRMFPN-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| IUPAC Names |
|---|
| 2-[(1R)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| (4R)-p-menth-1-en-8-ol |
| Synonyms | Source |
|---|---|
| (R)-(+)-alpha-Terpineol | KEGG COMPOUND |
| (+)-p-menth-1-en-8-ol | ChEBI |
| (R)-α,α,4-trimethylcyclohex-3-ene-1-methanol | ChemIDplus |
| (1R)-α,α,4-trimethyl-3-cyclohexene-1-methanol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-α-terpineol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09902 | KEGG COMPOUND |
| LMPR0102090028 | LIPID MAPS |
| C00010931 | KNApSAcK |
| C00029674 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5729447 | Beilstein |
| Reaxys:2041428 | Reaxys |
| CAS:7785-53-7 | KEGG COMPOUND |
| CAS:7785-53-7 | ChemIDplus |