EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | [H][C@@]1(C(C)(C)O)CC=C(C)CC1 |
| InChI | InChI=1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | WUOACPNHFRMFPN-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(−)-α-terpineol (CHEBI:128) has role plant metabolite (CHEBI:76924) |
| (S)-(−)-α-terpineol (CHEBI:128) is a α-terpineol (CHEBI:22469) |
| (S)-(−)-α-terpineol (CHEBI:128) is enantiomer of (R)-(+)-α-terpineol (CHEBI:300) |
| Incoming Relation(s) |
| (R)-(+)-α-terpineol (CHEBI:300) is enantiomer of (S)-(−)-α-terpineol (CHEBI:128) |
| IUPAC Names |
|---|
| 2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| (4S)-p-menth-1-en-8-ol |
| Synonyms | Source |
|---|---|
| (1S)-α,α,4-trimethyl-3-cyclohexene-1-methanol | ChemIDplus |
| (-)-alpha-Terpineol | KEGG COMPOUND |
| (S)-(−)-p-menth-1-en-8-ol | ChemIDplus |
| (S)-α,α,4-trimethyl-3-cyclohexene-1-methanol | NIST Chemistry WebBook |
| (L)-alpha-Terpineol | KEGG COMPOUND |
| (−)-α-terpineol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (S)-α-terpineol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00010932 | KNApSAcK |
| C11393 | KEGG COMPOUND |
| CPD-4887 | MetaCyc |
| HMDB0036086 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2325137 | Reaxys |
| Beilstein:3648762 | Beilstein |
| CAS:10482-56-1 | KEGG COMPOUND |
| CAS:10482-56-1 | NIST Chemistry WebBook |
| CAS:10482-56-1 | ChemIDplus |