EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O5 |
| Net Charge | 0 |
| Average Mass | 312.321 |
| Monoisotopic Mass | 312.09977 |
| SMILES | COc1cc2oc(-c3ccccc3)cc(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | HJNJAUYFFFOFBW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Callicarpa japonica (ncbitaxon:105891) | - | PubMed (9222055) |
| Roles Classification |
|---|
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,7-trimethoxyflavone (CHEBI:2980) has functional parent baicalein (CHEBI:2979) |
| 5,6,7-trimethoxyflavone (CHEBI:2980) has role anti-HSV-1 agent (CHEBI:64953) |
| 5,6,7-trimethoxyflavone (CHEBI:2980) has role plant metabolite (CHEBI:76924) |
| 5,6,7-trimethoxyflavone (CHEBI:2980) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| Baicalein 5,6,7-trimethyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003808 | KNApSAcK |
| C10024 | KEGG COMPOUND |
| LMPK12111100 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:300583 | Reaxys |
| CAS:973-67-1 | KEGG COMPOUND |
| Citations |
|---|