EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6 |
| Net Charge | -2 |
| Average Mass | 224.168 |
| Monoisotopic Mass | 224.03319 |
| SMILES | C=C(O[C@H]1C=CC=C(C(=O)[O-])[C@@H]1O)C(=O)[O-] |
| InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m0/s1 |
| InChIKey | NTGWPRCCOQCMGE-YUMQZZPRSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isochorismate(2−) (CHEBI:29780) is a dicarboxylic acid dianion (CHEBI:28965) |
| isochorismate(2−) (CHEBI:29780) is conjugate base of isochorismic acid (CHEBI:17582) |
| Incoming Relation(s) |
| isochorismic acid (CHEBI:17582) is conjugate acid of isochorismate(2−) (CHEBI:29780) |
| IUPAC Name |
|---|
| (5S,6S)-5-[(1-carboxylatoethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylate |
| Synonym | Source |
|---|---|
| Isochorismate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| isochorismate | UniProt |