EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | C=C(O[C@H]1C=CC=C(C(=O)O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | NTGWPRCCOQCMGE-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isochorismic acid (CHEBI:17582) is a 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid (CHEBI:36166) |
| isochorismic acid (CHEBI:17582) is conjugate acid of isochorismate(2−) (CHEBI:29780) |
| Incoming Relation(s) |
| isochorismate(2−) (CHEBI:29780) is conjugate base of isochorismic acid (CHEBI:17582) |
| IUPAC Name |
|---|
| (5S,6S)-5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| Isochorismic acid | KEGG COMPOUND |