EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C=O)[C@@]1([H])[C@@]2(C)CC[C@H](O)[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O4/c1-11-8-20-9-12(11)4-5-14(20)18(2)7-6-15(22)19(3,17(23)24)16(18)13(20)10-21/h10,12-16,22H,1,4-9H2,2-3H3,(H,23,24)/t12-,13+,14+,15+,16+,18+,19-,20-/m1/s1 |
| InChIKey | YMDYUWHAQBYOMU-HYAYUQHRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A14 aldehyde (CHEBI:29589) has functional parent gibberellin A14 (CHEBI:29588) |
| gibberellin A14 aldehyde (CHEBI:29589) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A14 aldehyde (CHEBI:29589) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A14 aldehyde (CHEBI:29589) is conjugate acid of gibberellin A14 aldehyde(1−) (CHEBI:143960) |
| Incoming Relation(s) |
| gibberellin A14 aldehyde(1−) (CHEBI:143960) is conjugate base of gibberellin A14 aldehyde (CHEBI:29589) |
| IUPAC Names |
|---|
| (1R,2S,3S,4S,5S,8S,9S,12R)-2-formyl-5-hydroxy-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-4-carboxylic acid |
| 10β-formyl-2β-hydroxy-1β,4a-dimethyl-8-methylidene-4aα,4bβ-gibbane-1α-carboxylic acid |
| Synonym | Source |
|---|---|
| Gibberellin A14 aldehyde | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11853 | KEGG COMPOUND |
| LMPR0104170010 | LIPID MAPS |
| C00007331 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2706728 | Reaxys |
| CAS:35470-76-9 | KEGG COMPOUND |